(2R)-N-[(1S)-2-[[(1S)-2-amino-1-methyl-2-oxo-ethyl]amino]-1-(2-naphthylmethyl)-2-oxo-ethyl]-2-[2-(hydroxyamino)-2-oxo-ethyl]-4-methyl-pentanamide

ID: ALA1234732

Max Phase: Preclinical

Molecular Formula: C24H32N4O5

Molecular Weight: 456.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)N[C@@H](C)C(N)=O

Standard InChI:  InChI=1S/C24H32N4O5/c1-14(2)10-19(13-21(29)28-33)23(31)27-20(24(32)26-15(3)22(25)30)12-16-8-9-17-6-4-5-7-18(17)11-16/h4-9,11,14-15,19-20,33H,10,12-13H2,1-3H3,(H2,25,30)(H,26,32)(H,27,31)(H,28,29)/t15-,19+,20-/m0/s1

Standard InChI Key:  CRCPLBFLOSEABN-BEVDRBHNSA-N

Molfile:  

     RDKit          2D

 33 34  0  0  0  0  0  0  0  0999 V2000
   -2.3891   -1.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2417   -1.0090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8974   -2.5232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0613   -1.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5530   -0.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2335   -2.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0696   -1.5768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2087   -1.9553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6921   -2.7124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5448    0.0320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4056    0.4105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1673   -1.1036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4056    4.0066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5861    4.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0778    1.1676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7335    3.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0944    3.4388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5696    1.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0696    2.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5282   -1.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2335    0.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3808   -2.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8395   -1.8607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3974   -0.8197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0199   -1.9553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2169   -0.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9139   -0.2519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2583    1.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2417    2.5871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4222    2.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5613   -2.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7087   -1.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0944   -0.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  3  2  0
  1  4  1  0
  1  8  1  0
  4  2  1  0
 27  2  1  0
  4  5  1  6
  6 31  1  0
  7 31  1  0
 25  9  2  0
 26 10  2  0
 27 11  2  0
 23 12  1  0
 13 14  2  0
 13 16  1  0
 14 17  1  0
 15 18  2  0
 15 28  1  0
 16 29  2  0
 17 30  2  0
 18 29  1  0
 19 28  2  0
 19 30  1  0
 20 25  1  0
 20 32  1  0
 21 28  1  0
 21 33  1  0
 22 31  1  0
 22 32  1  0
 25 23  1  0
 26 24  1  0
 33 24  1  6
 32 26  1  1
 27 33  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA1234732

    ---

Associated Targets(non-human)

Adam17 ADAM17 (101 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.54Molecular Weight (Monoisotopic): 456.2373AlogP: 1.41#Rotatable Bonds: 11
Polar Surface Area: 150.62Molecular Species: NEUTRALHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.90CX Basic pKa: CX LogP: 1.28CX LogD: 1.26
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.26Np Likeness Score: 0.05

References

1. Shagufta, Ahmad I..  (2021)  The race to treat COVID-19: Potential therapeutic agents for the prevention and treatment of SARS-CoV-2.,  213  [PMID:33486200] [10.1016/j.ejmech.2021.113157]

Source