N-(4-chloro-1-oxo-3-phenethoxy-1H-isochromen-7-yl)-6-(6-(5-((3aR,4R,6aS)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamido)hexanamido)hexanamide

ID: ALA1241101

PubChem CID: 23643985

Max Phase: Preclinical

Molecular Formula: C39H50ClN5O7S

Molecular Weight: 768.38

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCCCNC(=O)CCCC[C@H]1SC[C@H]2NC(=O)N[C@H]21)NCCCCCC(=O)Nc1ccc2c(Cl)c(OCCc3ccccc3)oc(=O)c2c1

Standard InChI:  InChI=1S/C39H50ClN5O7S/c40-35-28-19-18-27(24-29(28)37(49)52-38(35)51-23-20-26-12-4-1-5-13-26)43-34(48)17-7-3-11-22-41-32(46)15-6-2-10-21-42-33(47)16-9-8-14-31-36-30(25-53-31)44-39(50)45-36/h1,4-5,12-13,18-19,24,30-31,36H,2-3,6-11,14-17,20-23,25H2,(H,41,46)(H,42,47)(H,43,48)(H2,44,45,50)/t30-,31-,36-/m1/s1

Standard InChI Key:  VVVPWOUPIRZCAH-PCJZJSDKSA-N

Molfile:  

     RDKit          2D

 55 59  0  0  0  0  0  0  0  0999 V2000
   12.4819    1.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4807    0.2852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1956   -0.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1938    1.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9091    1.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9079    0.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6248   -0.1322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3475    0.2810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3487    1.1141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6272    1.5340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6273    2.3590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6225   -0.9572    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.0608   -0.1335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7764    0.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4897   -0.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2054    0.2730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9159   -0.1445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6310    0.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6338    1.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9154    1.5055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2032    1.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7673    1.5249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0530    1.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3384    1.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0532    0.2872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6240    1.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9094    1.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1951    1.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4805    1.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7661    1.1112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0516    1.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0514    2.3485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3372    1.1108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6226    1.5232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9083    1.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1937    1.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4793    1.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7647    1.5225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0504    1.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3358    1.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0506    0.2848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3786    1.1095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0931    1.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8075    1.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5221    1.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6075    2.3387    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4145    2.5101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2746    1.1826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8251    1.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5822    1.4670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4997    0.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6915    0.4684    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6917    0.6000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4167    2.3875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1153    0.0949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
 26 27  1  0
  8 13  1  0
 27 28  1  0
  3  6  2  0
 28 29  1  0
 13 14  1  0
 29 30  1  0
  1  2  2  0
 30 31  1  0
 14 15  1  0
 31 32  2  0
  5  4  2  0
 31 33  1  0
 15 16  1  0
 33 34  1  0
  4  1  1  0
 34 35  1  0
 16 17  2  0
 35 36  1  0
  5 10  1  0
 36 37  1  0
 17 18  1  0
 37 38  1  0
  6  7  1  0
 38 39  1  0
 18 19  2  0
 39 40  1  0
  7  8  2  0
 39 41  2  0
 19 20  1  0
 40 42  1  0
  8  9  1  0
 42 43  1  0
 20 21  2  0
 43 44  1  0
 21 16  1  0
 45 44  1  6
 45 46  1  0
  9 10  1  0
  1 22  1  0
 46 47  1  0
 47 49  1  0
 48 45  1  0
 48 49  1  0
  5  6  1  0
 22 23  1  0
 10 11  2  0
 23 24  1  0
 49 50  1  0
 50 51  1  0
 51 52  1  0
 52 48  1  0
 23 25  2  0
 48 53  1  1
  7 12  1  0
 49 54  1  1
 24 26  1  0
 51 55  2  0
M  END

Associated Targets(non-human)

Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Protease, putative (11 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SUB1 Subtilisin-like protease (110 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 768.38Molecular Weight (Monoisotopic): 767.3119AlogP: 6.09#Rotatable Bonds: 22
Polar Surface Area: 167.87Molecular Species: NEUTRALHBA: 8HBD: 5
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 3
CX Acidic pKa: 13.19CX Basic pKa: CX LogP: 4.87CX LogD: 4.87
Aromatic Rings: 3Heavy Atoms: 53QED Weighted: 0.06Np Likeness Score: -0.47

References

1. Arastu-Kapur S, Ponder EL, Fonović UP, Yeoh S, Yuan F, Fonović M, Grainger M, Phillips CI, Powers JC, Bogyo M..  (2008)  Identification of proteases that regulate erythrocyte rupture by the malaria parasite Plasmodium falciparum.,  (3): [PMID:18246061] [10.1038/nchembio.70]
2. Lidumniece E, Withers-Martinez C, Hackett F, Blackman MJ, Jirgensons A..  (2022)  Subtilisin-like Serine Protease 1 (SUB1) as an Emerging Antimalarial Drug Target: Current Achievements in Inhibitor Discovery.,  65  (19.0): [PMID:36137276] [10.1021/acs.jmedchem.2c01093]

Source