11-((S,E)-3-((S)-2-amino-3-(4-hydroxy-3-nitrophenyl)propanamido)-5-phenylpent-1-enylsulfonyl)-N-((S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)undecanamide

ID: ALA1241103

PubChem CID: 23643994

Max Phase: Preclinical

Molecular Formula: C40H53N5O9S

Molecular Weight: 779.96

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCCCCCCCCS(=O)(=O)/C=C/[C@H](CCc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)c([N+](=O)[O-])c1

Standard InChI:  InChI=1S/C40H53N5O9S/c41-34(26-31-18-22-37(47)36(28-31)45(51)52)40(50)43-32(19-15-29-12-8-7-9-13-29)23-25-55(53,54)24-11-6-4-2-1-3-5-10-14-38(48)44-35(39(42)49)27-30-16-20-33(46)21-17-30/h7-9,12-13,16-18,20-23,25,28,32,34-35,46-47H,1-6,10-11,14-15,19,24,26-27,41H2,(H2,42,49)(H,43,50)(H,44,48)/b25-23+/t32-,34-,35-/m0/s1

Standard InChI Key:  CSHWCGNIXJHXMY-YLJLSDLWSA-N

Molfile:  

     RDKit          2D

 55 57  0  0  0  0  0  0  0  0999 V2000
    2.3605   -9.1829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7724   -9.8997    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.1887   -9.1837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2254  -10.3256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5114   -9.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7974  -10.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0835   -9.9080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6305  -10.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3445   -9.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0585  -10.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4864  -10.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2004   -9.8955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9144  -10.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6283   -9.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3423  -10.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0563   -9.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7703  -10.2963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4842   -9.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1982  -10.2921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9122   -9.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6262  -10.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3402   -9.8746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0541  -10.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7681   -9.8704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4821  -10.2796    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5132   -9.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2301   -8.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2297   -7.8474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9457   -7.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6618   -7.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6573   -8.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9407   -9.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9457   -6.6052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6624   -6.1930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2305   -6.1906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3792   -7.4399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7956  -11.1481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6323  -11.1438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3492  -11.5557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3510  -12.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6346  -12.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6361  -13.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3535  -14.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0709  -13.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0660  -12.7867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6280  -11.1147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0559  -11.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7728  -11.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7713  -12.3474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4873  -12.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2033  -12.3441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1989  -11.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4823  -11.1053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9208  -12.7550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7663   -9.0437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 27 28  2  0
  7  8  1  0
 28 29  1  0
 14 15  1  0
 29 30  2  0
  4  5  1  0
 30 31  1  0
 15 16  1  0
 31 32  2  0
 32 27  1  0
  8  9  1  0
 16 17  1  0
  3  2  2  0
 33 34  2  0
 33 35  1  0
 29 33  1  0
 17 18  1  0
 30 36  1  0
  9 10  2  0
  6 37  2  0
 18 19  1  0
  8 38  1  6
 10  2  1  0
 38 39  1  0
 19 20  1  0
 39 40  1  0
  5  6  1  0
 40 41  2  0
 20 21  1  0
 41 42  1  0
  2 11  1  0
 42 43  2  0
 21 22  1  0
 43 44  1  0
 44 45  2  0
 45 40  1  0
 22 23  1  0
 21 46  2  0
 11 12  1  0
 23 47  1  6
 23 24  1  0
 47 48  1  0
  6  7  1  0
 48 49  2  0
 24 25  1  0
 49 50  1  0
 12 13  1  0
 50 51  2  0
  5 26  1  1
 51 52  1  0
  2  1  2  0
 52 53  2  0
 53 48  1  0
 26 27  1  0
 51 54  1  0
 13 14  1  0
 24 55  2  0
M  CHG  2  33   1  35  -1
M  END

Associated Targets(non-human)

DPAP1 Probable cathepsin C (4 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Preprocathepsin c, putative (3 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 779.96Molecular Weight (Monoisotopic): 779.3564AlogP: 4.65#Rotatable Bonds: 25
Polar Surface Area: 245.05Molecular Species: NEUTRALHBA: 10HBD: 6
#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 3
CX Acidic pKa: 6.63CX Basic pKa: 7.67CX LogP: 4.19CX LogD: 4.18
Aromatic Rings: 3Heavy Atoms: 55QED Weighted: 0.04Np Likeness Score: 0.04

References

1. Arastu-Kapur S, Ponder EL, Fonović UP, Yeoh S, Yuan F, Fonović M, Grainger M, Phillips CI, Powers JC, Bogyo M..  (2008)  Identification of proteases that regulate erythrocyte rupture by the malaria parasite Plasmodium falciparum.,  (3): [PMID:18246061] [10.1038/nchembio.70]

Source