(S)-2-amino-3-(4-hydroxy-3-nitrophenyl)-N-((S,E)-5-phenyl-1-(phenylsulfonyl)pent-1-en-3-yl)propanamide

ID: ALA1242746

PubChem CID: 23643996

Max Phase: Preclinical

Molecular Formula: C26H27N3O6S

Molecular Weight: 509.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N[C@@H](Cc1ccc(O)c([N+](=O)[O-])c1)C(=O)N[C@H](/C=C/S(=O)(=O)c1ccccc1)CCc1ccccc1

Standard InChI:  InChI=1S/C26H27N3O6S/c27-23(17-20-12-14-25(30)24(18-20)29(32)33)26(31)28-21(13-11-19-7-3-1-4-8-19)15-16-36(34,35)22-9-5-2-6-10-22/h1-10,12,14-16,18,21,23,30H,11,13,17,27H2,(H,28,31)/b16-15+/t21-,23-/m0/s1

Standard InChI Key:  MHWKYKCRSVNTCO-IFEIPUBUSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    3.7706   -9.0132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1805   -9.7292    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.5971   -9.0154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8208  -10.1417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1064   -9.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6081  -10.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1064   -8.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8208   -8.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8181   -7.6656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5317   -7.2532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2471   -7.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2445   -8.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5303   -8.9037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5315   -6.4240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2458   -6.0112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8168   -6.0119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9622   -7.2542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6081  -10.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3226   -9.7292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0371  -10.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7515   -9.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0371  -10.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7515  -11.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7515  -12.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0340  -12.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0336  -13.4377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7486  -13.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4655  -13.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4623  -12.6112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4660  -10.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8949  -10.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8931  -10.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6067  -11.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3221  -10.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3195  -10.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6053   -9.7297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  9 10  1  0
  6 19  1  0
  5  6  1  0
 19 20  1  0
 10 11  2  0
 20 21  1  0
 20 22  1  6
 11 12  1  0
 22 23  1  0
  5  7  1  1
 23 24  1  0
 12 13  2  0
 24 25  2  0
 13  8  1  0
 25 26  1  0
  2  1  2  0
 26 27  2  0
  7  8  1  0
 27 28  1  0
  4  5  1  0
 28 29  2  0
 29 24  1  0
 14 15  2  0
 21 30  2  0
 30  2  1  0
 14 16  1  0
  2 31  1  0
 10 14  1  0
 31 32  2  0
  8  9  2  0
 32 33  1  0
 11 17  1  0
 33 34  2  0
  3  2  2  0
 34 35  1  0
  6 18  2  0
 35 36  2  0
 36 31  1  0
M  CHG  2  14   1  16  -1
M  END

Associated Targets(non-human)

Protease, putative (11 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.58Molecular Weight (Monoisotopic): 509.1621AlogP: 3.28#Rotatable Bonds: 11
Polar Surface Area: 152.63Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.63CX Basic pKa: 7.67CX LogP: 3.03CX LogD: 3.02
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: -0.13

References

1. Arastu-Kapur S, Ponder EL, Fonović UP, Yeoh S, Yuan F, Fonović M, Grainger M, Phillips CI, Powers JC, Bogyo M..  (2008)  Identification of proteases that regulate erythrocyte rupture by the malaria parasite Plasmodium falciparum.,  (3): [PMID:18246061] [10.1038/nchembio.70]

Source