(3S,4R)-Ethanesulfonic acid (6-fluoro-3-hydroxy-2,2-dimethyl-chroman-4-yl)-methyl-amide

ID: ALA124812

PubChem CID: 11823263

Max Phase: Preclinical

Molecular Formula: C14H20FNO4S

Molecular Weight: 317.38

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)N(C)[C@@H]1c2cc(F)ccc2OC(C)(C)[C@H]1O

Standard InChI:  InChI=1S/C14H20FNO4S/c1-5-21(18,19)16(4)12-10-8-9(15)6-7-11(10)20-14(2,3)13(12)17/h6-8,12-13,17H,5H2,1-4H3/t12-,13+/m1/s1

Standard InChI Key:  OHZDQMLJSUBQLE-OLZOCXBDSA-N

Molfile:  

     RDKit          2D

 21 22  0  0  1  0  0  0  0  0999 V2000
    3.2542   -3.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -2.4000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -4.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -2.8125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -4.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -4.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -5.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -4.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6875   -2.8125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -1.5750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -3.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -5.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6875   -1.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -3.6417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167   -4.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167   -4.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042   -3.6417    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.6875   -4.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9667   -5.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -2.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -2.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  1  1  0
  1  4  1  1
  5  1  1  0
  6  5  1  0
  7  6  1  0
  8  3  1  0
  9  2  2  0
 10  2  2  0
 11  3  2  0
 12  8  2  0
 13  2  1  0
  5 14  1  6
 15 11  1  0
 16 15  2  0
 17 15  1  0
 18  6  1  0
 19  6  1  0
 20  4  1  0
 21 13  1  0
  7  8  1  0
 12 16  1  0
M  END

Associated Targets(Human)

KCNQ1 Tclin Voltage-gated potassium channel, IKs; KCNQ1(Kv7.1)/KCNE1(MinK) (185 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 317.38Molecular Weight (Monoisotopic): 317.1097AlogP: 1.68#Rotatable Bonds: 3
Polar Surface Area: 66.84Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.22CX Basic pKa: CX LogP: 1.09CX LogD: 1.09
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.92Np Likeness Score: -0.30

References

1. Gerlach U, Brendel J, Lang HJ, Paulus EF, Weidmann K, Brüggemann A, Busch AE, Suessbrich H, Bleich M, Greger R..  (2001)  Synthesis and activity of novel and selective I(Ks)-channel blockers.,  44  (23): [PMID:11689069] [10.1021/jm0109255]

Source