The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
trans-Isopropyl-(L-valyl)-L-serin-O3-yl Ester 9-{[(5S)-2-Hydroxy-2-oxido-1,4,2-dioxaphosphinan-5-yl]methyl}-2,6-diaminopurine ID: ALA1257399
PubChem CID: 52945320
Max Phase: Preclinical
Molecular Formula: C20H33N8O7P
Molecular Weight: 528.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)[C@@H](CO[P@]1(=O)CO[C@@H](Cn2cnc3c(N)nc(N)nc32)CO1)NC(=O)[C@@H](N)C(C)C
Standard InChI: InChI=1S/C20H33N8O7P/c1-10(2)14(21)18(29)25-13(19(30)35-11(3)4)7-34-36(31)9-32-12(6-33-36)5-28-8-24-15-16(22)26-20(23)27-17(15)28/h8,10-14H,5-7,9,21H2,1-4H3,(H,25,29)(H4,22,23,26,27)/t12-,13+,14-,36-/m0/s1
Standard InChI Key: DUNXKVFMHGQXKD-NGWTYAELSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
10.2741 -5.2348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9946 -4.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9918 -3.9827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2723 -3.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5552 -4.8179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5564 -3.9847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7644 -3.7275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2762 -4.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7624 -5.0727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7578 -5.8987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4742 -6.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4680 -7.1494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1801 -7.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9033 -7.1607 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
10.9098 -6.3308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1931 -5.9057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6158 -6.7361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3076 -7.8693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1324 -7.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7138 -5.2329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2698 -2.7446 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5412 -8.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3661 -8.5942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1251 -9.3023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3002 -9.2981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8841 -10.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8913 -8.5816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0591 -10.0062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2929 -10.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8768 -11.4392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1178 -10.7311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7750 -9.3107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7822 -7.8819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6071 -7.8861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0233 -7.1737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0160 -8.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
14 17 2 0
14 18 1 6
18 19 1 0
2 20 1 0
4 21 1 0
19 22 1 0
5 1 1 0
22 23 1 0
1 2 2 0
22 24 1 6
2 3 1 0
24 25 1 0
3 4 2 0
25 26 1 0
4 6 1 0
25 27 2 0
5 6 2 0
26 28 1 6
6 7 1 0
26 29 1 0
7 8 2 0
29 30 1 0
8 9 1 0
29 31 1 0
9 5 1 0
23 32 2 0
9 10 1 0
23 33 1 0
11 10 1 1
33 34 1 0
11 12 1 0
34 35 1 0
11 16 1 0
34 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.51Molecular Weight (Monoisotopic): 528.2210AlogP: -0.01#Rotatable Bonds: 10Polar Surface Area: 221.82Molecular Species: BASEHBA: 14HBD: 4#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.00CX Basic pKa: 8.51CX LogP: -0.55CX LogD: -1.71Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -0.15
References 1. Krecmerová M, Holý A, Andrei G, Pomeisl K, Tichý T, Brehová P, Masojídková M, Dracínský M, Pohl R, Laflamme G, Naesens L, Hui H, Cihlar T, Neyts J, De Clercq E, Balzarini J, Snoeck R.. (2010) Synthesis of ester prodrugs of 9-(S)-[3-hydroxy-2-(phosphonomethoxy)propyl]-2,6-diaminopurine (HPMPDAP) as anti-poxvirus agents., 53 (19): [PMID:20809641 ] [10.1021/jm901828c ]