The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
neopetrosiamine A ID: ALA1258043
PubChem CID: 49765082
Max Phase: Preclinical
Molecular Formula: C30H52N2
Molecular Weight: 440.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C1=C\CCCCN2CC[C@@H]3[C@@H](CCCC/C=C\CCCCN4C[C@H](CCCC/1)C[C@H]3C4)C2
Standard InChI: InChI=1S/C30H52N2/c1-3-7-11-15-20-31-22-19-30-28(25-31)18-14-10-6-2-4-8-12-16-21-32-24-27(17-13-9-5-1)23-29(30)26-32/h1-4,27-30H,5-26H2/b3-1-,4-2-/t27-,28+,29+,30-/m1/s1
Standard InChI Key: VDKGIMKVQUXITF-MYWASIGGSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
6.4237 -12.6899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0864 -13.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7574 -12.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5106 -11.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6866 -11.9094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8786 -9.1463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4740 -9.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8960 -10.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7142 -10.5645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1279 -11.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7051 -9.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1185 -9.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9441 -9.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3617 -9.1320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9440 -8.4145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1131 -8.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8396 -10.5311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1631 -9.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5867 -9.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4188 -9.8185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6723 -9.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9974 -8.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2428 -9.8132 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.7688 -11.2567 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.5350 -11.9776 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.7688 -9.8302 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.3659 -10.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9540 -11.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3643 -11.9794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6054 -11.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1882 -10.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9531 -12.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3665 -13.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1901 -13.4053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6019 -12.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4276 -11.2482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
6 7 1 0
6 11 1 0
7 8 1 0
9 8 1 0
12 9 1 0
9 10 1 0
10 28 1 0
27 13 1 0
11 16 1 0
12 13 1 0
14 15 1 0
15 16 2 0
14 18 1 0
31 19 1 0
36 30 1 0
36 17 1 0
17 20 1 0
19 20 1 0
20 21 1 0
21 22 1 0
18 22 1 0
20 23 1 6
31 24 1 6
28 25 1 6
27 26 1 6
27 28 1 0
27 31 1 0
28 29 1 0
30 31 1 0
29 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 1 2 0
36 5 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.76Molecular Weight (Monoisotopic): 440.4130AlogP: 7.46#Rotatable Bonds: ┄Polar Surface Area: 6.48Molecular Species: BASEHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.53CX LogP: 7.55CX LogD: 3.95Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: 0.87
References 1. Wei X, Nieves K, Rodríguez AD.. (2010) Neopetrosiamine A, biologically active bis-piperidine alkaloid from the Caribbean sea sponge Neopetrosia proxima., 20 (19): [PMID:20727745 ] [10.1016/j.bmcl.2010.07.084 ]