1-(8-(2,3-Dimethylphenyl)-10,11-dihydrodibenzo[b,f]thiepin-10-yl)-4-methylpiperazine

ID: ALA1259080

PubChem CID: 49781679

Max Phase: Preclinical

Molecular Formula: C27H30N2S

Molecular Weight: 414.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(-c2ccc3c(c2)C(N2CCN(C)CC2)Cc2ccccc2S3)c1C

Standard InChI:  InChI=1S/C27H30N2S/c1-19-7-6-9-23(20(19)2)21-11-12-27-24(17-21)25(29-15-13-28(3)14-16-29)18-22-8-4-5-10-26(22)30-27/h4-12,17,25H,13-16,18H2,1-3H3

Standard InChI Key:  ALJFHHUCGXIRIJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   15.0592  -25.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8634  -25.3823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0238  -27.0417    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.4056  -26.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3951  -25.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6982  -25.3286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0114  -25.7383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0259  -26.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7232  -26.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1963  -26.1296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8019  -26.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2650  -27.6129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1223  -27.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5146  -26.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0492  -26.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8814  -24.3755    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4932  -23.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3181  -23.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5325  -22.7659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9217  -23.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0965  -24.1309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3577  -21.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2904  -25.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2787  -24.5154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5585  -24.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8498  -24.5386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8658  -25.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5865  -25.7648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6039  -26.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1596  -25.7942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 11  3  1  0
 14 15  2  0
 15 10  1  0
  6  7  2  0
  1 16  1  0
 16 17  1  0
  3  4  1  0
  7  8  1  0
  2 10  1  0
  8  9  2  0
  9  4  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
  1  5  1  0
  7 23  1  0
 10 11  2  0
 23 24  2  0
  4  5  2  0
 24 25  1  0
 11 12  1  0
 25 26  2  0
  1  2  1  0
 26 27  1  0
 12 13  2  0
 27 28  2  0
 28 23  1  0
  5  6  1  0
 28 29  1  0
 13 14  1  0
 27 30  1  0
M  END

Associated Targets(Human)

DRD2 Tclin Dopamine D2 receptor (23596 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

ADRA1A Alpha-1a adrenergic receptor (303 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRA1B Alpha-1b adrenergic receptor (201 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Adra1d Alpha-1d adrenergic receptor (1475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.62Molecular Weight (Monoisotopic): 414.2130AlogP: 5.97#Rotatable Bonds: 2
Polar Surface Area: 6.48Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.25CX LogP: 6.72CX LogD: 5.82
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.51Np Likeness Score: -0.40

References

1. Kristensen JL, Püschl A, Jensen M, Risgaard R, Christoffersen CT, Bang-Andersen B, Balle T..  (2010)  Exploring the neuroleptic substituent in octoclothepin: potential ligands for positron emission tomography with subnanomolar affinity for α(1)-adrenoceptors.,  53  (19): [PMID:20857909] [10.1021/jm100652h]

Source