1-(8-(2,5-Dimethylphenyl)-10,11-dihydrodibenzo[b,f]thiepin-10-yl)-4-methylpiperazine

ID: ALA1259097

PubChem CID: 49781680

Max Phase: Preclinical

Molecular Formula: C27H30N2S

Molecular Weight: 414.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(C)c1-c1ccc2c(c1)C(N1CCN(C)CC1)Cc1ccccc1S2

Standard InChI:  InChI=1S/C27H30N2S/c1-19-7-6-8-20(2)27(19)22-11-12-26-23(17-22)24(29-15-13-28(3)14-16-29)18-21-9-4-5-10-25(21)30-26/h4-12,17,24H,13-16,18H2,1-3H3

Standard InChI Key:  KQRHCJXCCFJNQW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   -1.0866    0.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2824    0.1177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1221   -1.5417    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7402   -1.0176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7508   -0.2177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4476    0.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1344   -0.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1199   -1.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4226   -1.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0505   -0.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3439   -1.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1191   -2.1129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9765   -2.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3687   -1.3048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9034   -0.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2644    1.1245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6526    1.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8277    2.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6133    2.7341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2242    2.1781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0494    1.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7881    3.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8554    0.1626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8671    0.9846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5873    1.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2960    0.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2800    0.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5593   -0.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5419   -1.0896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1589    1.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 11  3  1  0
 14 15  2  0
 15 10  1  0
  6  7  2  0
  1 16  1  0
 16 17  1  0
  3  4  1  0
  7  8  1  0
  2 10  1  0
  8  9  2  0
  9  4  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
  1  5  1  0
  7 23  1  0
 10 11  2  0
 23 24  2  0
  4  5  2  0
 24 25  1  0
 11 12  1  0
 25 26  2  0
  1  2  1  0
 26 27  1  0
 12 13  2  0
 27 28  2  0
 28 23  1  0
  5  6  1  0
 28 29  1  0
 13 14  1  0
 24 30  1  0
M  END

Associated Targets(Human)

DRD2 Tclin Dopamine D2 receptor (23596 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

ADRA1A Alpha-1a adrenergic receptor (303 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRA1B Alpha-1b adrenergic receptor (201 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Adra1d Alpha-1d adrenergic receptor (1475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.62Molecular Weight (Monoisotopic): 414.2130AlogP: 5.97#Rotatable Bonds: 2
Polar Surface Area: 6.48Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.24CX LogP: 6.72CX LogD: 5.83
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.51Np Likeness Score: -0.25

References

1. Kristensen JL, Püschl A, Jensen M, Risgaard R, Christoffersen CT, Bang-Andersen B, Balle T..  (2010)  Exploring the neuroleptic substituent in octoclothepin: potential ligands for positron emission tomography with subnanomolar affinity for α(1)-adrenoceptors.,  53  (19): [PMID:20857909] [10.1021/jm100652h]

Source