1-(8-Mesityl-10,11-dihydrodibenzo[b,f]thiepin-10-yl)-4-methylpiperazine

ID: ALA1259098

PubChem CID: 49781681

Max Phase: Preclinical

Molecular Formula: C28H32N2S

Molecular Weight: 428.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c(-c2ccc3c(c2)C(N2CCN(C)CC2)Cc2ccccc2S3)c(C)c1

Standard InChI:  InChI=1S/C28H32N2S/c1-19-15-20(2)28(21(3)16-19)23-9-10-27-24(17-23)25(30-13-11-29(4)12-14-30)18-22-7-5-6-8-26(22)31-27/h5-10,15-17,25H,11-14,18H2,1-4H3

Standard InChI Key:  XNFVTFMFMPGVGG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    8.2384    0.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0426    0.1469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2029   -1.5125    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.5848   -0.9884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5742   -0.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8774    0.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1906   -0.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2051   -1.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9024   -1.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3755   -0.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9811   -1.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4441   -2.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3015   -2.0431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6937   -1.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2284   -0.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0606    1.1537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6724    1.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4973    2.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7117    2.7632    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1008    2.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2756    1.3983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5369    3.5695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4696    0.1918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4579    1.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7377    1.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0290    0.9906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0450    0.1615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7657   -0.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7831   -1.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1661    1.4369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3074    1.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 14 15  2  0
 15 10  1  0
  6  7  2  0
  1 16  1  0
 16 17  1  0
  3  4  1  0
  7  8  1  0
  2 10  1  0
  8  9  2  0
  9  4  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
  1  5  1  0
  7 23  1  0
 10 11  2  0
 23 24  2  0
  4  5  2  0
 24 25  1  0
 11 12  1  0
 25 26  2  0
  1  2  1  0
 26 27  1  0
 12 13  2  0
 27 28  2  0
 28 23  1  0
  5  6  1  0
 28 29  1  0
 13 14  1  0
 24 30  1  0
 11  3  1  0
 26 31  1  0
M  END

Associated Targets(Human)

DRD2 Tclin Dopamine D2 receptor (23596 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

ADRA1A Alpha-1a adrenergic receptor (303 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRA1B Alpha-1b adrenergic receptor (201 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Adra1d Alpha-1d adrenergic receptor (1475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.65Molecular Weight (Monoisotopic): 428.2286AlogP: 6.27#Rotatable Bonds: 2
Polar Surface Area: 6.48Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.24CX LogP: 7.24CX LogD: 6.34
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -0.29

References

1. Kristensen JL, Püschl A, Jensen M, Risgaard R, Christoffersen CT, Bang-Andersen B, Balle T..  (2010)  Exploring the neuroleptic substituent in octoclothepin: potential ligands for positron emission tomography with subnanomolar affinity for α(1)-adrenoceptors.,  53  (19): [PMID:20857909] [10.1021/jm100652h]

Source