1-Methyl-4-[8-(2-methyl-2H-tetrazol-5-ylmethyl)-10,11-dihydro-dibenzo[b,f]thiepin-10-yl]piperazine

ID: ALA1259128

PubChem CID: 49781890

Max Phase: Preclinical

Molecular Formula: C22H26N6S

Molecular Weight: 406.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCN(C2Cc3ccccc3Sc3ccc(Cc4nnn(C)n4)cc32)CC1

Standard InChI:  InChI=1S/C22H26N6S/c1-26-9-11-28(12-10-26)19-15-17-5-3-4-6-20(17)29-21-8-7-16(13-18(19)21)14-22-23-25-27(2)24-22/h3-8,13,19H,9-12,14-15H2,1-2H3

Standard InChI Key:  HMSQOZVGOAWQNS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    7.0842   -6.5353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8884   -6.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0488   -8.3958    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.4306   -7.8717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4201   -7.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7232   -6.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0364   -7.0925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0509   -7.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7482   -8.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2213   -7.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8269   -8.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2900   -8.9670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1473   -8.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5396   -8.1590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0742   -7.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9064   -5.7297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5182   -5.1756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3431   -4.3731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5575   -4.1201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9467   -4.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1215   -5.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3827   -3.3138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3154   -6.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6077   -7.1155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8510   -6.7967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3089   -7.4186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7329   -8.1264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5370   -7.9418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4096   -8.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 13 14  1  0
 11  3  1  0
 14 15  2  0
 15 10  1  0
  6  7  2  0
  1 16  1  0
 16 17  1  0
  3  4  1  0
  7  8  1  0
  2 10  1  0
  8  9  2  0
  9  4  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
  1  5  1  0
  7 23  1  0
 10 11  2  0
 23 24  1  0
 24 25  1  0
  4  5  2  0
 11 12  1  0
  1  2  1  0
 12 13  2  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 24  2  0
  5  6  1  0
 27 29  1  0
M  END

Associated Targets(Human)

DRD2 Tclin Dopamine D2 receptor (23596 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Adra1b Alpha-1b adrenergic receptor (2470 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRA1B Alpha-1b adrenergic receptor (201 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Adra1d Alpha-1d adrenergic receptor (1475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.56Molecular Weight (Monoisotopic): 406.1940AlogP: 2.80#Rotatable Bonds: 3
Polar Surface Area: 50.08Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.94CX LogP: 4.32CX LogD: 3.67
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -0.81

References

1. Kristensen JL, Püschl A, Jensen M, Risgaard R, Christoffersen CT, Bang-Andersen B, Balle T..  (2010)  Exploring the neuroleptic substituent in octoclothepin: potential ligands for positron emission tomography with subnanomolar affinity for α(1)-adrenoceptors.,  53  (19): [PMID:20857909] [10.1021/jm100652h]

Source