1-Methyl-4-(8-(1-methyl-1H-pyrazol-5-yl)-10,11-dihydrodibenzo[b,f]thiepin-10-yl)piperazine

ID: ALA1259231

PubChem CID: 49781234

Max Phase: Preclinical

Molecular Formula: C23H26N4S

Molecular Weight: 390.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCN(C2Cc3ccccc3Sc3ccc(-c4ccnn4C)cc32)CC1

Standard InChI:  InChI=1S/C23H26N4S/c1-25-11-13-27(14-12-25)21-16-18-5-3-4-6-22(18)28-23-8-7-17(15-19(21)23)20-9-10-24-26(20)2/h3-10,15,21H,11-14,16H2,1-2H3

Standard InChI Key:  AJESKKMIWNWSBT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
    7.9759    0.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7801    0.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9404   -0.9000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3223   -0.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3117    0.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6149    0.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9281    0.4034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9426   -0.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6399   -0.7849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1130    0.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7186   -0.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1816   -1.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0390   -1.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4312   -0.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9659    0.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7981    1.7662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4099    2.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2348    3.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4492    3.3757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8383    2.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0131    2.0108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2744    4.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2071    0.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2165    1.6256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4365    1.8944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9399    1.2355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4131    0.5597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1453   -0.2206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
 13 14  1  0
 11  3  1  0
 14 15  2  0
 15 10  1  0
  6  7  2  0
  1 16  1  0
 16 17  1  0
  3  4  1  0
  7  8  1  0
  2 10  1  0
  8  9  2  0
  9  4  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
  1  5  1  0
  7 23  1  0
 23 24  2  0
 10 11  2  0
  4  5  2  0
 11 12  1  0
  1  2  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  1  0
 12 13  2  0
 27 28  1  0
M  END

Associated Targets(Human)

DRD2 Tclin Dopamine D2 receptor (23596 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

ADRA1A Alpha-1a adrenergic receptor (303 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRA1B Alpha-1b adrenergic receptor (201 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Adra1d Alpha-1d adrenergic receptor (1475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.56Molecular Weight (Monoisotopic): 390.1878AlogP: 4.08#Rotatable Bonds: 2
Polar Surface Area: 24.30Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.10CX LogP: 4.05CX LogD: 3.27
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.66Np Likeness Score: -0.85

References

1. Kristensen JL, Püschl A, Jensen M, Risgaard R, Christoffersen CT, Bang-Andersen B, Balle T..  (2010)  Exploring the neuroleptic substituent in octoclothepin: potential ligands for positron emission tomography with subnanomolar affinity for α(1)-adrenoceptors.,  53  (19): [PMID:20857909] [10.1021/jm100652h]

Source