The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(N-hydroxy-2-(phosphonooxy)acetamido)butyl hexanoate ID: ALA1278086
PubChem CID: 49836534
Max Phase: Preclinical
Molecular Formula: C12H24NO8P
Molecular Weight: 341.30
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCC(=O)OCCCCN(O)C(=O)COP(=O)(O)O
Standard InChI: InChI=1S/C12H24NO8P/c1-2-3-4-7-12(15)20-9-6-5-8-13(16)11(14)10-21-22(17,18)19/h16H,2-10H2,1H3,(H2,17,18,19)
Standard InChI Key: QCADYHRFELDWBS-UHFFFAOYSA-N
Molfile:
RDKit 2D
22 21 0 0 0 0 0 0 0 0999 V2000
-4.1168 -3.8126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4043 -3.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6918 -3.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9793 -3.3959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2667 -3.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5543 -3.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1583 -3.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8708 -3.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5834 -3.7959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8318 -3.4010 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-5.5457 -3.8143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2501 -2.8126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.4209 -2.8126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6900 -4.6334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9811 -2.5708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2965 -3.3812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0124 -3.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2938 -2.5561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7256 -3.3766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4413 -3.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1546 -3.3720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8703 -3.7822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
10 12 2 0
1 2 1 0
10 13 1 0
6 7 1 0
3 14 2 0
3 4 1 0
4 15 1 0
7 8 1 0
9 16 1 0
16 17 1 0
8 9 1 0
16 18 2 0
4 5 1 0
17 19 1 0
1 10 1 0
19 20 1 0
2 3 1 0
20 21 1 0
10 11 1 0
21 22 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 341.30Molecular Weight (Monoisotopic): 341.1240AlogP: 1.22#Rotatable Bonds: 12Polar Surface Area: 133.60Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.31CX Basic pKa: ┄CX LogP: 0.61CX LogD: -2.90Aromatic Rings: ┄Heavy Atoms: 22QED Weighted: 0.16Np Likeness Score: 0.57
References 1. Daher R, Coinçon M, Fonvielle M, Gest PM, Guerin ME, Jackson M, Sygusch J, Therisod M.. (2010) Rational design, synthesis, and evaluation of new selective inhibitors of microbial class II (zinc dependent) fructose bis-phosphate aldolases., 53 (21): [PMID:20929256 ] [10.1021/jm1009814 ]