The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 4-((S)-1-((R)-1-((S)-1-((S)-2-((R)-1-chloro-4-methyl-2-oxopentan-3-ylcarbamoyl)pyrrolidin-1-yl)-1-oxopropan-2-ylamino)-1-oxopropan-2-ylamino)-1-oxopropan-2-ylamino)-4-oxobutanoate ID: ALA1290140
PubChem CID: 52947317
Max Phase: Preclinical
Molecular Formula: C25H40ClN5O8
Molecular Weight: 574.08
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CCC(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(=O)CCl)C(C)C
Standard InChI: InChI=1S/C25H40ClN5O8/c1-13(2)21(18(32)12-26)30-24(37)17-8-7-11-31(17)25(38)16(5)29-23(36)15(4)28-22(35)14(3)27-19(33)9-10-20(34)39-6/h13-17,21H,7-12H2,1-6H3,(H,27,33)(H,28,35)(H,29,36)(H,30,37)/t14-,15+,16-,17-,21+/m0/s1
Standard InChI Key: WPRNYPXVPOXZMZ-JXVINKLPSA-N
Molfile:
RDKit 2D
39 39 0 0 0 0 0 0 0 0999 V2000
1.0296 -6.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7467 -6.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3165 -6.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3967 -6.8379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3165 -5.6011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1067 -6.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4598 -6.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1730 -6.4229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4598 -7.6597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8903 -6.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6033 -6.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8903 -7.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3164 -6.8379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6033 -5.6011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0296 -6.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7467 -6.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0296 -5.6011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7467 -7.6597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4598 -6.4229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1729 -6.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8860 -6.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1729 -7.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6025 -6.8386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8860 -5.6011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6829 -7.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4907 -7.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9018 -7.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3562 -6.4993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5297 -5.6929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3097 -5.4281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9079 -5.1512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4682 -4.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2483 -4.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8464 -4.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0090 -3.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0663 -4.3405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4067 -3.5421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8701 -4.8945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1869 -3.2774 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19 20 1 0
1 3 1 0
20 21 1 0
10 11 1 0
20 22 1 6
4 6 1 0
21 23 1 0
10 12 1 6
21 24 2 0
23 25 1 0
1 2 1 0
11 13 1 0
2 7 1 0
11 14 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 23 1 0
3 4 1 0
28 29 1 6
13 15 1 0
29 30 1 0
7 8 1 0
29 31 2 0
15 16 1 0
32 30 1 6
32 33 1 0
15 17 1 6
32 34 1 0
7 9 2 0
34 35 1 0
16 18 2 0
34 36 1 0
3 5 2 0
33 37 1 0
16 19 1 0
33 38 2 0
8 10 1 0
37 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.08Molecular Weight (Monoisotopic): 573.2565AlogP: -0.61#Rotatable Bonds: 14Polar Surface Area: 180.08Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.80CX Basic pKa: ┄CX LogP: -0.91CX LogD: -0.91Aromatic Rings: ┄Heavy Atoms: 39QED Weighted: 0.16Np Likeness Score: -0.38
References 1. Kore AR, Shanmugasundaram M.. (2010) Design, synthesis and inhibitory effect of pentapeptidyl chloromethyl ketones on proteinase K., 18 (23): [PMID:20937562 ] [10.1016/j.bmc.2010.09.048 ]