Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

(S)-2-amino-4-((((2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl)(2-(methylamino)ethyl)amino)butanoic acid

ID: ALA1290415

PubChem CID: 50915249

Max Phase: Preclinical

Molecular Formula: C17H28N8O5

Molecular Weight: 424.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNCCN(CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C17H28N8O5/c1-20-3-5-24(4-2-9(18)17(28)29)6-10-12(26)13(27)16(30-10)25-8-23-11-14(19)21-7-22-15(11)25/h7-10,12-13,16,20,26-27H,2-6,18H2,1H3,(H,28,29)(H2,19,21,22)/t9-,10+,12+,13+,16+/m0/s1

Standard InChI Key:  RWADDOCFGSZJCV-UOYPZJKHSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   -1.7616   -0.0269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4816    0.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0527    0.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4927    1.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0639    1.2201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3661    2.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2126    1.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2237    2.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9437    2.8314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7490   -1.9752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0760   -1.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3344   -1.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3339   -0.7051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0002   -1.1908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1199   -0.9410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3422   -0.3977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5212   -0.3172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5192   -1.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8064   -1.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8106   -2.4419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5269   -2.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2404   -2.4304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2327   -1.6087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7550   -0.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3550    1.6421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5149    2.8507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9215    1.1816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9437   -1.1903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5588   -2.6458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2361   -2.6410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 10  1  0
 12 15  1  1
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 15  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 14 24  1  1
 24  1  1  0
  5 25  1  0
  6 25  1  0
  8 26  1  0
  7 27  1  6
 23 28  1  0
 11 29  1  6
 10 30  1  6
M  END

Associated Targets(Human)

SETD7 Tchem Histone-lysine N-methyltransferase SETD7 (390 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Calculated Properties

Molecular Weight: 424.46Molecular Weight (Monoisotopic): 424.2183AlogP: -2.65#Rotatable Bonds: 10
Polar Surface Area: 197.90Molecular Species: ZWITTERIONHBA: 12HBD: 6
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.75CX Basic pKa: 10.01CX LogP: -5.52CX LogD: -6.93
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.23Np Likeness Score: 0.71

References

1. Mori S, Iwase K, Iwanami N, Tanaka Y, Kagechika H, Hirano T..  (2010)  Development of novel bisubstrate-type inhibitors of histone methyltransferase SET7/9.,  18  (23): [PMID:21036620] [10.1016/j.bmc.2010.10.022]
2. Barsyte-Lovejoy, Dalia D and 32 more authors.  2014-09-02  (R)-PFI-2 is a potent and selective inhibitor of SETD7 methyltransferase activity in cells.  [PMID:25136132]
3. Kaniskan, H Ümit; Konze, Kyle D and Jin, Jian.  2015-02-26  Selective inhibitors of protein methyltransferases.  [PMID:25406853]
4. Takemoto, Yasushi Y and 16 more authors.  2016-04-28  Identification of Cyproheptadine as an Inhibitor of SET Domain Containing Lysine Methyltransferase 7/9 (Set7/9) That Regulates Estrogen-Dependent Transcription.  [PMID:27088648]
5. Min, Wenjian and 10 more authors.  2020-04-01  Computational discovery and biological evaluation of novel inhibitors targeting histone-lysine N-methyltransferase SET7.  [PMID:32088124]

Source