The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Amino-2-{4-[(2-amino-4-oxo-5-trifluoromethyl-3,4-dihydro-quinazolin-6-ylmethyl)-amino]-benzoylamino}-pentanoic acid ID: ALA130518
PubChem CID: 136046106
Max Phase: Preclinical
Molecular Formula: C22H23F3N6O4
Molecular Weight: 492.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCC(NC(=O)c1ccc(NCc2ccc3nc(N)nc(O)c3c2C(F)(F)F)cc1)C(=O)O
Standard InChI: InChI=1S/C22H23F3N6O4/c23-22(24,25)17-12(5-8-14-16(17)19(33)31-21(27)30-14)10-28-13-6-3-11(4-7-13)18(32)29-15(20(34)35)2-1-9-26/h3-8,15,28H,1-2,9-10,26H2,(H,29,32)(H,34,35)(H3,27,30,31,33)
Standard InChI Key: QMDKLKMYZJMJMO-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
-0.9208 -2.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4333 -2.5792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3958 -2.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4333 -3.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9208 -3.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3958 -3.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1250 -2.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1250 -1.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -1.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2792 -1.6625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7917 -0.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7917 -1.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9208 -1.6667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6417 -2.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2417 -1.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1250 -3.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -0.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6792 -2.5667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2750 -0.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1667 -2.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9583 -3.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6417 -3.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1250 -1.1292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.6125 -1.2750 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.3625 -1.2792 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.2417 -2.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7167 -1.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -2.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3125 -0.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1917 -1.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7167 -2.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8750 -1.3542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3167 -1.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3542 -1.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8375 -1.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 2 1 0
5 6 1 0
6 3 2 0
7 3 1 0
8 7 1 0
9 15 1 0
10 9 1 0
11 12 1 0
12 10 1 0
13 1 1 0
14 7 2 0
15 26 2 0
16 6 1 0
17 9 2 0
18 20 1 0
19 11 2 0
20 14 1 0
21 4 1 0
22 14 1 0
23 8 1 0
24 8 1 0
25 8 1 0
26 31 1 0
27 30 2 0
28 18 1 0
29 11 1 0
30 28 1 0
31 28 2 0
32 34 1 0
33 12 1 0
34 35 1 0
35 33 1 0
4 5 2 0
16 22 2 0
15 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.46Molecular Weight (Monoisotopic): 492.1733AlogP: 2.47#Rotatable Bonds: 9Polar Surface Area: 176.48Molecular Species: ZWITTERIONHBA: 8HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 8#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.48CX Basic pKa: 9.82CX LogP: -0.08CX LogD: -0.08Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -0.54
References 1. Hynes JB, Singh SK, Fetzer O, Shane B.. (1992) Inhibition of hog liver folylpolyglutamate synthetase by 5-substituted 5,8-dideaza analogues of folic acid bearing a terminal L-ornithine residue., 35 (22): [PMID:1433214 ] [10.1021/jm00100a013 ]