5-Amino-2-{4-[(2-amino-4-oxo-5-trifluoromethyl-3,4-dihydro-quinazolin-6-ylmethyl)-amino]-benzoylamino}-pentanoic acid

ID: ALA130518

PubChem CID: 136046106

Max Phase: Preclinical

Molecular Formula: C22H23F3N6O4

Molecular Weight: 492.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCCCC(NC(=O)c1ccc(NCc2ccc3nc(N)nc(O)c3c2C(F)(F)F)cc1)C(=O)O

Standard InChI:  InChI=1S/C22H23F3N6O4/c23-22(24,25)17-12(5-8-14-16(17)19(33)31-21(27)30-14)10-28-13-6-3-11(4-7-13)18(32)29-15(20(34)35)2-1-9-26/h3-8,15,28H,1-2,9-10,26H2,(H,29,32)(H,34,35)(H3,27,30,31,33)

Standard InChI Key:  QMDKLKMYZJMJMO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   -0.9208   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4333   -2.5792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3958   -2.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4333   -3.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9208   -3.4792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3958   -3.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1250   -2.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1250   -1.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7542   -1.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2792   -1.6625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7917   -0.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7917   -1.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9208   -1.6667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6417   -2.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2417   -1.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1250   -3.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7542   -0.7667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6792   -2.5667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2750   -0.4625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1667   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9583   -3.4792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6417   -3.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1250   -1.1292    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.6125   -1.2750    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3625   -1.2792    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.2417   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -1.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2042   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3125   -0.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1917   -1.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -2.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8750   -1.3542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3167   -1.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3542   -1.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8375   -1.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  2  1  0
  5  6  1  0
  6  3  2  0
  7  3  1  0
  8  7  1  0
  9 15  1  0
 10  9  1  0
 11 12  1  0
 12 10  1  0
 13  1  1  0
 14  7  2  0
 15 26  2  0
 16  6  1  0
 17  9  2  0
 18 20  1  0
 19 11  2  0
 20 14  1  0
 21  4  1  0
 22 14  1  0
 23  8  1  0
 24  8  1  0
 25  8  1  0
 26 31  1  0
 27 30  2  0
 28 18  1  0
 29 11  1  0
 30 28  1  0
 31 28  2  0
 32 34  1  0
 33 12  1  0
 34 35  1  0
 35 33  1  0
  4  5  2  0
 16 22  2  0
 15 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA130518

    ---

Associated Targets(Human)

FPGS Tchem Folylpoly-gamma-glutamate synthetase (250 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 492.46Molecular Weight (Monoisotopic): 492.1733AlogP: 2.47#Rotatable Bonds: 9
Polar Surface Area: 176.48Molecular Species: ZWITTERIONHBA: 8HBD: 6
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 8#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.48CX Basic pKa: 9.82CX LogP: -0.08CX LogD: -0.08
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -0.54

References

1. Hynes JB, Singh SK, Fetzer O, Shane B..  (1992)  Inhibition of hog liver folylpolyglutamate synthetase by 5-substituted 5,8-dideaza analogues of folic acid bearing a terminal L-ornithine residue.,  35  (22): [PMID:1433214] [10.1021/jm00100a013]

Source