17,20,23,26,29-pentaoxa-4,14,32-triazahexacyclo[30.6.1.17,14.02,6.08,13.033,38]tetraconta-1(39),2(6),7(40),8,10,12,33,35,37-nonaene-3,5-dione

ID: ALA130774

PubChem CID: 10144680

Max Phase: Preclinical

Molecular Formula: C32H35N3O7

Molecular Weight: 573.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NC(=O)C2=C1c1cn(c3ccccc13)CCOCCOCCOCCOCCOCCn1cc2c2ccccc21

Standard InChI:  InChI=1S/C32H35N3O7/c36-31-29-25-21-34(27-7-3-1-5-23(25)27)9-11-38-13-15-40-17-19-42-20-18-41-16-14-39-12-10-35-22-26(30(29)32(37)33-31)24-6-2-4-8-28(24)35/h1-8,21-22H,9-20H2,(H,33,36,37)

Standard InChI Key:  QLNNQGZYMRYENG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 42 47  0  0  0  0  0  0  0  0999 V2000
    0.5000   -2.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2625   -1.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9542   -2.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2792   -3.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1792   -1.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0458   -1.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3792   -0.9792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8667   -3.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8167   -3.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3917   -4.4417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6167   -3.5875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7625   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4833   -3.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1750   -2.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4083   -4.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7917   -0.6042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8708   -1.7542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7792   -6.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6875   -7.1792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2042   -4.0417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5417   -6.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5875   -4.7917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8167   -4.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6792   -5.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2333   -3.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1750   -1.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0042   -2.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0833   -4.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6167   -4.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4917   -5.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8750   -7.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5917   -6.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2125   -6.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3542   -6.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8750   -5.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0167   -6.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7750   -4.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4875   -3.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9083   -3.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0042   -1.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8333   -4.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4167   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  2  1  0
  6  1  1  0
  7  6  1  0
  8  3  2  0
  9  4  2  0
 10  9  1  0
 11  8  1  0
 12  3  1  0
 13  4  1  0
 14 12  1  0
 15 13  1  0
 16  5  2  0
 17  6  2  0
 18 30  1  0
 19 31  1  0
 20 29  1  0
 21 36  1  0
 22 37  1  0
 23 11  1  0
 24 10  1  0
 25 13  2  0
 26 12  2  0
 27 14  2  0
 28 15  2  0
 29 23  1  0
 30 24  1  0
 31 32  1  0
 32 18  1  0
 33 19  1  0
 34 35  1  0
 35 22  1  0
 36 33  1  0
 37 38  1  0
 38 20  1  0
 39 25  1  0
 40 26  1  0
 41 39  2  0
 42 40  2  0
  7  5  1  0
 10 15  1  0
 11 14  1  0
 41 28  1  0
 27 42  1  0
 34 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA130774

    CID 10144680

Associated Targets(Human)

PRKCG Tchem Protein kinase C gamma (2471 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GSK3B Tclin Glycogen synthase kinase-3 beta (11785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 573.65Molecular Weight (Monoisotopic): 573.2475AlogP: 3.26#Rotatable Bonds:
Polar Surface Area: 102.18Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.71CX Basic pKa: CX LogP: 2.94CX LogD: 2.94
Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.32Np Likeness Score: -0.21

References

1. Kuo GH, Prouty C, DeAngelis A, Shen L, O'Neill DJ, Shah C, Connolly PJ, Murray WV, Conway BR, Cheung P, Westover L, Xu JZ, Look RA, Demarest KT, Emanuel S, Middleton SA, Jolliffe L, Beavers MP, Chen X..  (2003)  Synthesis and discovery of macrocyclic polyoxygenated bis-7-azaindolylmaleimides as a novel series of potent and highly selective glycogen synthase kinase-3beta inhibitors.,  46  (19): [PMID:12954055] [10.1021/jm030115o]

Source