The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24386390 ID: ALA1314412
PubChem CID: 4900953
Max Phase: Preclinical
Molecular Formula: C24H25ClN6O2
Molecular Weight: 464.96
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cn1c(=O)[nH]c(=O)c2c1nc(CN1CCN(c3cccc(Cl)c3)CC1)n2Cc1ccccc1
Standard InChI: InChI=1S/C24H25ClN6O2/c1-28-22-21(23(32)27-24(28)33)31(15-17-6-3-2-4-7-17)20(26-22)16-29-10-12-30(13-11-29)19-9-5-8-18(25)14-19/h2-9,14H,10-13,15-16H2,1H3,(H,27,32,33)
Standard InChI Key: QNKCYRFVCIAPFT-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-4.6903 0.6978 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.6438 7.3491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7852 4.8741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1428 6.3666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6438 4.8741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1428 5.0317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0707 6.1116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8653 4.9847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6903 3.5557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3582 6.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3582 5.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6278 5.6991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6438 6.5241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0707 5.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3978 7.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4528 5.6991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8458 7.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6438 4.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4528 4.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6903 4.9847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8653 3.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1028 4.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1007 8.5489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0388 7.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1028 2.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6903 2.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9278 2.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5487 9.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4867 8.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1028 1.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7417 8.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3403 2.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9278 1.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 30 1 0
2 13 2 0
3 14 2 0
4 10 1 0
4 12 1 0
4 15 1 0
5 11 1 0
5 14 1 0
5 18 1 0
6 11 1 0
6 12 2 0
7 13 1 0
7 14 1 0
8 16 1 0
8 19 1 0
8 20 1 0
9 21 1 0
9 22 1 0
9 25 1 0
10 11 2 0
10 13 1 0
12 16 1 0
15 17 1 0
17 23 2 0
17 24 1 0
19 21 1 0
20 22 1 0
23 28 1 0
24 29 2 0
25 26 2 0
25 27 1 0
26 30 1 0
27 32 2 0
28 31 2 0
29 31 1 0
30 33 2 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.96Molecular Weight (Monoisotopic): 464.1728AlogP: 2.45#Rotatable Bonds: 5Polar Surface Area: 79.16Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.21CX Basic pKa: 5.51CX LogP: 3.31CX LogD: 3.30Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -1.87
References 1. PubChem BioAssay data set,