The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-{2-Fluoro-4-[2-(2-fluoro-benzyl)-3-oxo-cyclohex-1-enylamino]-phenyl}-4,4-dimethyl-2,4-dihydro-pyrazol-3-one ID: ALA131672
PubChem CID: 23647054
Max Phase: Preclinical
Molecular Formula: C24H23F2N3O2
Molecular Weight: 423.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)C(=O)NN=C1c1ccc(NC2=C(Cc3ccccc3F)C(=O)CCC2)cc1F
Standard InChI: InChI=1S/C24H23F2N3O2/c1-24(2)22(28-29-23(24)31)16-11-10-15(13-19(16)26)27-20-8-5-9-21(30)17(20)12-14-6-3-4-7-18(14)25/h3-4,6-7,10-11,13,27H,5,8-9,12H2,1-2H3,(H,29,31)
Standard InChI Key: VDLINFRONRFGGR-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
4.0542 -2.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4167 -3.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -3.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7667 1.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0542 -2.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5167 -4.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7042 -4.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7667 0.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0542 2.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7750 -1.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0542 0.4625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4792 2.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7750 -0.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3417 -1.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0542 2.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0542 -0.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2625 -4.8292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3417 3.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4875 2.8125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4917 -2.0250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.3417 -0.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -3.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9917 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6292 2.9375 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4792 0.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2000 1.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2000 0.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7750 3.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3417 4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7792 4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0625 4.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 8 2 0
5 1 1 0
6 3 1 0
7 2 1 0
8 11 1 0
9 4 1 0
10 5 2 0
11 16 1 0
12 4 1 0
13 10 1 0
14 5 1 0
15 9 1 0
16 21 1 0
17 7 2 0
18 15 1 0
19 12 2 0
20 10 1 0
21 14 2 0
22 2 1 0
23 2 1 0
24 18 1 0
25 8 1 0
26 27 1 0
27 25 1 0
28 15 2 0
29 18 2 0
30 28 1 0
31 30 2 0
6 7 1 0
16 13 2 0
26 12 1 0
31 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.46Molecular Weight (Monoisotopic): 423.1758AlogP: 4.49#Rotatable Bonds: 5Polar Surface Area: 70.56Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.64CX Basic pKa: 1.68CX LogP: 4.55CX LogD: 4.55Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.74Np Likeness Score: -0.63
References 1. Edmondson SD, Mastracchio A, He J, Chung CC, Forrest MJ, Hofsess S, MacIntyre E, Metzger J, O'Connor N, Patel K, Tong X, Tota MR, Van der Ploeg LH, Varnerin JP, Fisher MH, Wyvratt MJ, Weber AE, Parmee ER.. (2003) Benzyl vinylogous amide substituted aryldihydropyridazinones and aryldimethylpyrazolones as potent and selective PDE3B inhibitors., 13 (22): [PMID:14592490 ] [10.1016/j.bmcl.2003.08.056 ]