The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,1-dimethyl-2-phenylcarboxamidohexanoic anhydride ID: ALA131704
PubChem CID: 44354931
Max Phase: Preclinical
Molecular Formula: C30H40N2O5
Molecular Weight: 508.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(NC(=O)c1ccccc1)C(C)(C)C(=O)OC(=O)C(C)(C)C(CCC)NC(=O)c1ccccc1
Standard InChI: InChI=1S/C30H40N2O5/c1-7-15-23(31-25(33)21-17-11-9-12-18-21)29(3,4)27(35)37-28(36)30(5,6)24(16-8-2)32-26(34)22-19-13-10-14-20-22/h9-14,17-20,23-24H,7-8,15-16H2,1-6H3,(H,31,33)(H,32,34)
Standard InChI Key: HPGZOBMWVCIJEN-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
1.6792 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1125 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9667 -1.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8250 -1.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3917 -1.6792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1750 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 -1.6792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4625 -1.6792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2542 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5417 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1125 -0.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6792 -0.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1750 -0.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -0.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6792 -1.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8875 -1.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3750 -2.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3750 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2375 -2.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 -2.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2542 -0.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5417 -0.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6792 -2.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3917 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6083 -1.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8875 -2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9667 -0.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 -0.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9667 0.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 0.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1042 -1.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3208 -1.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6000 -2.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3917 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3208 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1125 -2.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 2 1 0
5 1 1 0
6 9 1 0
7 8 1 0
8 11 1 0
9 10 1 0
10 3 1 0
11 4 1 0
12 2 2 0
13 1 2 0
14 6 2 0
15 7 2 0
16 7 1 0
17 6 1 0
18 3 1 0
19 3 1 0
20 4 1 0
21 4 1 0
10 22 1 0
11 23 1 0
24 16 2 0
25 16 1 0
26 17 2 0
27 17 1 0
28 22 1 0
29 23 1 0
30 28 1 0
31 29 1 0
32 25 2 0
33 26 1 0
34 27 2 0
35 24 1 0
36 34 1 0
37 32 1 0
33 36 2 0
35 37 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.66Molecular Weight (Monoisotopic): 508.2937AlogP: 5.31#Rotatable Bonds: 12Polar Surface Area: 101.57Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.62CX LogD: 6.62Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -0.11
References 1. Iijima K, Katada J, Hayashi Y.. (1999) Symmetrical anhydride-type serine protease inhibitors: structure-activity relationship studies of human chymase inhibitors., 9 (3): [PMID:10091694 ] [10.1016/s0960-894x(99)00012-8 ]