17,20-dioxa-4,12,14,23,25-pentaazahexacyclo[21.6.1.17,14.02,6.08,13.024,29]hentriaconta-1(30),2(6),7(31),8,10,12,24,26,28-nonaene-3,5-dione

ID: ALA132223

PubChem CID: 10114332

Max Phase: Preclinical

Molecular Formula: C24H21N5O4

Molecular Weight: 443.46

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NC(=O)C2=C1c1cn(c3ncccc13)CCOCCOCCn1cc2c2cccnc21

Standard InChI:  InChI=1S/C24H21N5O4/c30-23-19-17-13-28(21-15(17)3-1-5-25-21)7-9-32-11-12-33-10-8-29-14-18(20(19)24(31)27-23)16-4-2-6-26-22(16)29/h1-6,13-14H,7-12H2,(H,27,30,31)

Standard InChI Key:  BXLMONUQKMHQEF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   -3.0333   -3.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2500   -2.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5833   -3.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2875   -3.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2500   -2.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5208   -2.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0333   -1.7667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7208   -4.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7958   -4.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2875   -5.2292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9750   -4.5292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3875   -3.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0833   -4.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0833   -4.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7625   -3.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4375   -3.9917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7958   -5.3792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5833   -1.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3458   -2.4375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9708   -6.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0417   -6.4625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0333   -6.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8500   -5.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3083   -2.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7958   -3.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8875   -3.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5083   -4.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0833   -5.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2250   -6.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1625   -7.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6083   -6.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5083   -4.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5125   -2.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  2  1  0
  6  1  1  0
  7  6  1  0
  8  3  2  0
  9  4  2  0
 10  9  1  0
 11  8  1  0
 12 15  1  0
 13 14  1  0
 14  4  1  0
 15  3  1  0
 16 12  2  0
 17 13  2  0
 18  5  2  0
 19  6  2  0
 20 29  1  0
 21 28  1  0
 22 10  1  0
 23 11  1  0
 24 15  2  0
 25 14  2  0
 26 33  2  0
 27 32  2  0
 28 23  1  0
 29 22  1  0
 30 20  1  0
 31 30  1  0
 32 25  1  0
 33 24  1  0
  7  5  1  0
 10 13  1  0
 11 12  1  0
 27 17  1  0
 16 26  1  0
 31 21  1  0
M  END

Associated Targets(Human)

PRKCG Tchem Protein kinase C gamma (2471 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GSK3B Tclin Glycogen synthase kinase-3 beta (11785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.46Molecular Weight (Monoisotopic): 443.1594AlogP: 2.00#Rotatable Bonds:
Polar Surface Area: 100.27Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.71CX Basic pKa: 3.68CX LogP: 1.38CX LogD: 1.38
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -0.42

References

1. Kuo GH, Prouty C, DeAngelis A, Shen L, O'Neill DJ, Shah C, Connolly PJ, Murray WV, Conway BR, Cheung P, Westover L, Xu JZ, Look RA, Demarest KT, Emanuel S, Middleton SA, Jolliffe L, Beavers MP, Chen X..  (2003)  Synthesis and discovery of macrocyclic polyoxygenated bis-7-azaindolylmaleimides as a novel series of potent and highly selective glycogen synthase kinase-3beta inhibitors.,  46  (19): [PMID:12954055] [10.1021/jm030115o]

Source