The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2,3-Bis-octadec-9-enoyloxy-propyl)-trimethyl-ammonium chloride ID: ALA133173
Cas Number: 132172-61-3
PubChem CID: 11636182
Product Number: D421240, Order Now?
Max Phase: Preclinical
Molecular Formula: C42H80ClNO4
Molecular Weight: 663.11
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC.[Cl-]
Standard InChI: InChI=1S/C42H80NO4.ClH/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41(44)46-39-40(38-43(3,4)5)47-42(45)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;/h20-23,40H,6-19,24-39H2,1-5H3;1H/q+1;/p-1/b22-20-,23-21-;
Standard InChI Key: KSXTUUUQYQYKCR-LQDDAWAPSA-M
Molfile:
RDKit 2D
48 46 0 0 0 0 0 0 0 0999 V2000
6.4625 -5.1792 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.1917 -3.9917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6292 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -2.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3042 -2.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3542 -2.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -3.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9042 -2.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0208 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7333 -3.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3917 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6750 -1.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1917 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9042 -3.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6042 -4.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1917 -4.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 -3.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6292 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9542 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3917 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7333 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2958 -3.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3042 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3542 -1.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5708 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1167 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4458 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2292 -1.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8833 0.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5542 -6.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5542 -5.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8833 0.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1708 -0.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5917 -3.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8667 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1417 -3.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7917 -1.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5167 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1167 -3.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8375 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8375 -4.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0667 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4458 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1708 -1.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6083 1.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2750 -6.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 5 1 0
4 10 1 0
5 6 1 0
6 9 1 0
7 3 2 0
8 4 2 0
9 2 1 0
10 15 1 0
11 24 1 0
12 11 2 0
13 14 2 0
14 21 1 0
15 6 1 0
16 2 1 0
17 2 1 0
18 2 1 0
19 3 1 0
20 4 1 0
21 30 1 0
22 13 1 0
23 12 1 0
24 27 1 0
25 19 1 0
26 20 1 0
27 38 1 0
28 22 1 0
29 23 1 0
30 40 1 0
31 34 1 0
32 33 1 0
33 43 1 0
34 35 1 0
35 46 1 0
36 25 1 0
37 36 1 0
38 37 1 0
39 44 1 0
40 39 1 0
41 28 1 0
42 41 1 0
43 42 1 0
44 26 1 0
45 29 1 0
46 45 1 0
47 31 1 0
48 32 1 0
M CHG 2 1 -1 2 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 663.11Molecular Weight (Monoisotopic): 662.6082AlogP: 12.22#Rotatable Bonds: 35Polar Surface Area: 52.60Molecular Species: ┄HBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 9.60CX LogD: 9.60Aromatic Rings: ┄Heavy Atoms: 47QED Weighted: 0.03Np Likeness Score: 0.56
References 1. Floch V, Loisel S, Guenin E, Hervé AC, Clement JC, Yaouanc JJ, des Abbayes H, Férec C.. (2000) Cation substitution in cationic phosphonolipids: a new concept to improve transfection activity and decrease cellular toxicity., 43 (24): [PMID:11101353 ] [10.1021/jm000006z ]