The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(3-Methyl-1,4-dioxo-1,4-dihydro-naphthalen-2-yl)-hexanoic acid 2,2-dimethyl-propionyloxymethyl ester ID: ALA133306
PubChem CID: 10927492
Max Phase: Preclinical
Molecular Formula: C23H28O6
Molecular Weight: 400.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(CCCCCC(=O)OCOC(=O)C(C)(C)C)C(=O)c2ccccc2C1=O
Standard InChI: InChI=1S/C23H28O6/c1-15-16(21(26)18-12-9-8-11-17(18)20(15)25)10-6-5-7-13-19(24)28-14-29-22(27)23(2,3)4/h8-9,11-12H,5-7,10,13-14H2,1-4H3
Standard InChI Key: AOBNIFUJMJOAQV-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
-0.7583 -1.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7583 -2.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4708 -0.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4750 -2.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1833 -1.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1875 -2.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3792 -2.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0917 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5250 -2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4708 0.0375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4833 -3.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6667 -2.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9542 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2375 -2.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3875 -1.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5292 -1.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0500 -2.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0458 -0.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8958 -2.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8958 -0.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 -2.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0917 -3.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8125 -2.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5042 -3.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6667 -2.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0917 -2.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3792 -2.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6083 -2.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6083 -1.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 2 1 0
5 3 1 0
6 5 2 0
7 12 1 0
8 7 1 0
9 21 1 0
10 3 2 0
11 4 2 0
12 13 1 0
13 14 1 0
14 9 1 0
15 7 2 0
16 9 2 0
17 2 1 0
18 1 1 0
19 6 1 0
20 5 1 0
21 26 1 0
22 8 1 0
23 8 1 0
24 8 1 0
25 17 1 0
26 27 1 0
27 25 1 0
28 29 1 0
29 20 2 0
4 6 1 0
19 28 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.47Molecular Weight (Monoisotopic): 400.1886AlogP: 4.42#Rotatable Bonds: 8Polar Surface Area: 86.74Molecular Species: ┄HBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.99CX LogD: 4.99Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.36Np Likeness Score: 0.77
References 1. Davioud-Charvet E, Delarue S, Biot C, Schwöbel B, Boehme CC, Müssigbrodt A, Maes L, Sergheraert C, Grellier P, Schirmer RH, Becker K.. (2001) A prodrug form of a Plasmodium falciparum glutathione reductase inhibitor conjugated with a 4-anilinoquinoline., 44 (24): [PMID:11708927 ] [10.1021/jm010268g ]