The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID26725162 ID: ALA1340117
PubChem CID: 16745457
Max Phase: Preclinical
Molecular Formula: C22H26N4O4
Molecular Weight: 410.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)C(=O)Nc1cccc(C2=NOC3(C2)C[C@@H](C(N)=O)N(C(=O)/C=C/CC)C3)c1
Standard InChI: InChI=1S/C22H26N4O4/c1-4-5-9-19(27)26-13-22(12-18(26)20(23)28)11-17(25-30-22)15-7-6-8-16(10-15)24-21(29)14(2)3/h5-10,18H,2,4,11-13H2,1,3H3,(H2,23,28)(H,24,29)/b9-5+/t18-,22?/m0/s1
Standard InChI Key: VESRJKLHANLKDM-CMVJWDLVSA-N
Molfile:
RDKit 2D
30 32 0 0 1 0 0 0 0 0999 V2000
-1.4499 0.6755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6255 -0.5538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7856 1.7259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7582 -2.0086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2043 -0.4045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6653 0.4205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6255 0.5699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1770 -0.7032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9348 0.0080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2043 0.4205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4197 -0.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4197 0.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4499 -0.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6653 -0.4045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8718 -0.8894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0022 -0.8894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8718 0.9055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7559 -0.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0841 -1.7099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7856 -1.7099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4233 -1.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5834 -2.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3371 -1.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4530 -2.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8444 -1.1881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5981 -0.8526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3668 -3.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2655 -1.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6843 -0.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0342 -3.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 6 1 0
1 9 1 0
2 15 2 0
3 17 2 0
4 25 2 0
5 10 1 0
5 11 1 0
5 15 1 0
6 14 2 0
7 17 1 0
8 21 1 0
8 25 1 0
9 11 1 0
9 12 1 0
9 13 1 0
10 12 1 0
10 17 1 6
13 14 1 0
14 16 1 0
15 20 1 0
16 18 1 0
16 19 2 0
18 21 2 0
19 22 1 0
20 24 2 0
21 23 1 0
22 23 2 0
24 27 1 0
25 26 1 0
26 28 2 0
26 29 1 0
27 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.47Molecular Weight (Monoisotopic): 410.1954AlogP: 2.12#Rotatable Bonds: 6Polar Surface Area: 114.09Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.06CX LogP: 1.83CX LogD: 1.83Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.70Np Likeness Score: -0.31
References 1. PubChem BioAssay data set,