The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,1-dimethyl-2-phenylcarboxamidopentanoic anhydride ID: ALA134068
PubChem CID: 44354971
Max Phase: Preclinical
Molecular Formula: C28H36N2O5
Molecular Weight: 480.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(NC(=O)c1ccccc1)C(C)(C)C(=O)OC(=O)C(C)(C)C(CC)NC(=O)c1ccccc1
Standard InChI: InChI=1S/C28H36N2O5/c1-7-21(29-23(31)19-15-11-9-12-16-19)27(3,4)25(33)35-26(34)28(5,6)22(8-2)30-24(32)20-17-13-10-14-18-20/h9-18,21-22H,7-8H2,1-6H3,(H,29,31)(H,30,32)
Standard InChI Key: CEAQLKDYOYEPQY-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
1.6792 -0.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1125 -0.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9667 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8250 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3917 -1.2667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1750 -0.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -0.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 -1.2667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4625 -1.2667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2542 -0.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5417 -0.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1125 -0.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6792 -0.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1750 -0.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -0.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6792 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8875 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3750 -1.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3750 -1.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2375 -1.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 -1.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2542 -0.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5417 -0.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6792 -2.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3917 -0.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6083 -0.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8875 -2.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9667 0.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 0.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6000 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3917 -2.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1042 -1.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3208 -1.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3208 -2.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1125 -2.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 2 1 0
5 1 1 0
6 9 1 0
7 8 1 0
8 11 1 0
9 10 1 0
10 3 1 0
11 4 1 0
12 2 2 0
13 1 2 0
14 6 2 0
15 7 2 0
16 7 1 0
17 6 1 0
18 3 1 0
19 3 1 0
20 4 1 0
21 4 1 0
10 22 1 0
11 23 1 0
24 16 2 0
25 16 1 0
26 17 2 0
27 17 1 0
28 22 1 0
29 23 1 0
30 27 2 0
31 24 1 0
32 25 2 0
33 26 1 0
34 30 1 0
35 32 1 0
33 34 2 0
31 35 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.61Molecular Weight (Monoisotopic): 480.2624AlogP: 4.53#Rotatable Bonds: 10Polar Surface Area: 101.57Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.74CX LogD: 5.74Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.12
References 1. Iijima K, Katada J, Hayashi Y.. (1999) Symmetrical anhydride-type serine protease inhibitors: structure-activity relationship studies of human chymase inhibitors., 9 (3): [PMID:10091694 ] [10.1016/s0960-894x(99)00012-8 ]