The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID865852 ID: ALA1353116
PubChem CID: 5390080
Max Phase: Preclinical
Molecular Formula: C24H25FN2O4
Molecular Weight: 424.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1Cc2cc(C(=O)C3=C(O)C(=O)N(CCN(C)C)C3c3ccccc3F)ccc2O1
Standard InChI: InChI=1S/C24H25FN2O4/c1-14-12-16-13-15(8-9-19(16)31-14)22(28)20-21(17-6-4-5-7-18(17)25)27(11-10-26(2)3)24(30)23(20)29/h4-9,13-14,21,29H,10-12H2,1-3H3
Standard InChI Key: YORFZOKUUKWPGU-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
0.0082 -0.3725 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.8416 1.8454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0860 2.2186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0292 -0.7646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.9572 1.5529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0090 0.7505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1169 1.2454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5611 0.1374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3147 0.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2285 1.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4215 1.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0292 0.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3895 -0.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7437 0.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6049 -0.9246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1885 0.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1726 0.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4582 0.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0026 -1.2216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1726 1.2979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7437 1.2979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4582 1.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9572 0.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4334 -1.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4422 0.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2964 1.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8311 -2.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0465 -2.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2672 0.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6018 1.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4524 0.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 15 1 0
2 10 1 0
3 11 2 0
4 12 2 0
5 20 1 0
5 25 1 0
6 8 1 0
6 11 1 0
6 16 1 0
7 26 1 0
7 30 1 0
7 31 1 0
8 9 1 0
8 13 1 0
9 10 2 0
9 12 1 0
10 11 1 0
12 14 1 0
13 15 1 0
13 19 2 0
14 18 1 0
14 21 2 0
15 24 2 0
16 26 1 0
17 18 2 0
17 20 1 0
17 23 1 0
19 27 1 0
20 22 2 0
21 22 1 0
23 25 1 0
24 28 1 0
25 29 1 0
27 28 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.47Molecular Weight (Monoisotopic): 424.1798AlogP: 3.29#Rotatable Bonds: 6Polar Surface Area: 70.08Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.53CX Basic pKa: 7.76CX LogP: 2.58CX LogD: 2.19Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.72Np Likeness Score: -1.08
References 1. PubChem BioAssay data set,