The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(3-Methyl-1,4-dioxo-1,4-dihydro-naphthalen-2-yl)-hexanoic acid butyryloxymethyl ester ID: ALA135755
PubChem CID: 10916047
Max Phase: Preclinical
Molecular Formula: C22H26O6
Molecular Weight: 386.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(=O)OCOC(=O)CCCCCC1=C(C)C(=O)c2ccccc2C1=O
Standard InChI: InChI=1S/C22H26O6/c1-3-9-19(23)27-14-28-20(24)13-6-4-5-10-16-15(2)21(25)17-11-7-8-12-18(17)22(16)26/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3
Standard InChI Key: MOVODEWFRQNJME-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
1.5042 -1.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5042 -2.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7917 -0.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7917 -2.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0792 -1.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0792 -2.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7917 -2.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6500 -2.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7792 -3.4167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8000 -0.1167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2167 -2.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9292 -2.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5042 -2.6292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8000 -1.3875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6542 -1.4042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2167 -2.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2250 -0.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6333 -0.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6333 -2.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3625 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0750 -2.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9375 -2.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0792 -2.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3625 -2.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6417 -2.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3375 -2.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3375 -1.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7917 -2.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 2 1 0
5 3 1 0
6 5 2 0
7 21 1 0
8 12 1 0
9 4 2 0
10 3 2 0
11 13 1 0
12 11 1 0
13 7 1 0
14 7 2 0
15 8 2 0
16 2 1 0
17 1 1 0
18 5 1 0
19 6 1 0
20 8 1 0
21 24 1 0
22 16 1 0
23 20 1 0
24 25 1 0
25 22 1 0
26 27 1 0
27 18 2 0
28 23 1 0
4 6 1 0
26 19 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 386.44Molecular Weight (Monoisotopic): 386.1729AlogP: 4.18#Rotatable Bonds: 10Polar Surface Area: 86.74Molecular Species: ┄HBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.34CX LogD: 4.34Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.34Np Likeness Score: 0.83
References 1. Davioud-Charvet E, Delarue S, Biot C, Schwöbel B, Boehme CC, Müssigbrodt A, Maes L, Sergheraert C, Grellier P, Schirmer RH, Becker K.. (2001) A prodrug form of a Plasmodium falciparum glutathione reductase inhibitor conjugated with a 4-anilinoquinoline., 44 (24): [PMID:11708927 ] [10.1021/jm010268g ]