The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(2,3-dihydroxylbenzyl)-N,N,N',N'-tetramethyl-1,6-hexanediamine dibromide ID: ALA136284
PubChem CID: 204061
Max Phase: Preclinical
Molecular Formula: C24H38Br2N2O4
Molecular Weight: 418.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[N+](C)(CCCCCC[N+](C)(C)Cc1cccc(O)c1O)Cc1cccc(O)c1O.[Br-].[Br-]
Standard InChI: InChI=1S/C24H36N2O4.2BrH/c1-25(2,17-19-11-9-13-21(27)23(19)29)15-7-5-6-8-16-26(3,4)18-20-12-10-14-22(28)24(20)30;;/h9-14H,5-8,15-18H2,1-4H3,(H2-2,27,28,29,30);2*1H
Standard InChI Key: USICBHXHIFVPQM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 31 0 0 0 0 0 0 0 0999 V2000
5.9917 -0.8125 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1.3542 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6917 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -1.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2042 -2.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8750 -0.6042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1792 -2.1542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3542 -0.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1750 -2.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7167 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -2.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4000 -1.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2042 -2.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4042 -2.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2417 -2.7542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8417 -1.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6875 -3.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4750 -0.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5792 -2.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8417 -2.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2042 -3.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4625 0.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3417 0.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6917 -1.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0167 -1.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3542 -2.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7167 -3.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2750 -1.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7750 -1.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3750 -1.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6750 -1.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 -0.3750 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3 9 1 0
4 2 2 0
5 3 1 0
6 8 1 0
7 19 1 0
8 2 1 0
9 7 1 0
10 5 2 0
11 4 1 0
12 4 1 0
13 5 1 0
14 11 1 0
15 10 1 0
16 2 1 0
17 3 2 0
18 6 1 0
19 28 1 0
20 16 2 0
21 17 1 0
22 6 1 0
23 6 1 0
24 7 1 0
25 7 1 0
26 20 1 0
27 21 2 0
28 31 1 0
29 18 1 0
30 29 1 0
31 30 1 0
11 26 2 0
27 10 1 0
M CHG 4 1 -1 6 1 7 1 32 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.58Molecular Weight (Monoisotopic): 418.2821AlogP: 3.92#Rotatable Bonds: 11Polar Surface Area: 80.92Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.54CX Basic pKa: ┄CX LogP: -4.41CX LogD: -2.87Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.25Np Likeness Score: 0.36
References 1. Gu Y, Lee H, Hudson RA.. (1994) Bis-catechol-substituted redox-reactive analogues of hexamethonium and decamethonium: stimulated affinity-dependent reactivity through iron peroxide catalysis., 37 (25): [PMID:7996555 ] [10.1021/jm00051a021 ] 2. Cai S, Mukherjee J, Tillekeratne LM, Hudson RA, Kirchhoff JR.. (2007) Inhibition of choline transport by redox-active cholinomimetic bis-catechol reagents., 15 (22): [PMID:17827016 ] [10.1016/j.bmc.2007.07.041 ]