The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID26725174 ID: ALA1368108
PubChem CID: 16745469
Max Phase: Preclinical
Molecular Formula: C21H24N4O4
Molecular Weight: 396.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)C(=O)Nc1cccc(C2=NOC3(C2)C[C@@H](C(N)=O)N(C(=O)C(=C)C)C3)c1
Standard InChI: InChI=1S/C21H24N4O4/c1-12(2)19(27)23-15-7-5-6-14(8-15)16-9-21(29-24-16)10-17(18(22)26)25(11-21)20(28)13(3)4/h5-8,17H,1,3,9-11H2,2,4H3,(H2,22,26)(H,23,27)/t17-,21?/m0/s1
Standard InChI Key: ZTBAYPBTARIWTP-PBVYKCSPSA-N
Molfile:
RDKit 2D
29 31 0 0 1 0 0 0 0 0999 V2000
-0.1697 1.5581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3453 0.3288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5054 2.6086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8783 0.0301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9242 0.4782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6149 1.3032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3453 1.4526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4572 0.1795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6546 0.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9242 1.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1395 0.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1395 1.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1697 0.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6149 0.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5916 -0.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2824 -0.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5916 1.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5054 -0.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0360 0.3288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1961 -0.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7035 -0.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8636 -1.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6172 -0.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7517 -1.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1728 -1.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1246 -0.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0384 -1.1259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7058 -1.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2847 -1.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 6 1 0
1 9 1 0
2 15 2 0
3 17 2 0
4 26 2 0
5 10 1 0
5 11 1 0
5 15 1 0
6 14 2 0
7 17 1 0
8 21 1 0
8 26 1 0
9 11 1 0
9 12 1 0
9 13 1 0
10 12 1 0
10 17 1 6
13 14 1 0
14 16 1 0
15 18 1 0
16 19 2 0
16 20 1 0
18 24 2 0
18 25 1 0
19 21 1 0
20 22 2 0
21 23 2 0
22 23 1 0
26 27 1 0
27 28 2 0
27 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 396.45Molecular Weight (Monoisotopic): 396.1798AlogP: 1.73#Rotatable Bonds: 5Polar Surface Area: 114.09Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.02CX LogP: 1.40CX LogD: 1.40Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.74Np Likeness Score: -0.61
References 1. PubChem BioAssay data set,