The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-Carbamimidoyl-phenyl)-2-[2-(4-thiocarbamoyl-benzenesulfonylamino)-acetylamino]-propionic acid ethyl ester ID: ALA137311
PubChem CID: 10767421
Max Phase: Preclinical
Molecular Formula: C21H25N5O5S2
Molecular Weight: 491.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C(Cc1ccc(C(=N)N)cc1)NC(=O)CNS(=O)(=O)c1ccc(C(=N)S)cc1
Standard InChI: InChI=1S/C21H25N5O5S2/c1-2-31-21(28)17(11-13-3-5-14(6-4-13)19(22)23)26-18(27)12-25-33(29,30)16-9-7-15(8-10-16)20(24)32/h3-10,17,25H,2,11-12H2,1H3,(H3,22,23)(H2,24,32)(H,26,27)
Standard InChI Key: XUBBHZIMNINHAR-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
8.7292 -0.3375 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.2667 0.0625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9125 1.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5292 2.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5292 -1.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0292 1.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3667 0.8583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1792 -0.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2417 0.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7000 -0.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6042 -0.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3000 -0.1417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0792 -1.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9792 2.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5292 3.2708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1042 -1.7250 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.3375 1.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5792 2.2583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6792 0.0750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0625 -1.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7417 -0.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2000 -0.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5125 -1.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8667 1.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5542 2.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0042 2.3583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4167 -2.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8875 1.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6042 2.0500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3167 1.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0042 2.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0625 1.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6292 1.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 7 1 0
4 14 1 0
5 13 1 0
6 3 1 0
7 9 1 0
8 1 1 0
9 10 1 0
10 2 1 0
11 1 2 0
12 1 2 0
13 22 1 0
14 25 2 0
15 4 2 0
16 5 1 0
17 3 1 0
18 6 2 0
19 9 2 0
20 8 2 0
21 8 1 0
22 21 2 0
23 20 1 0
24 30 2 0
25 31 1 0
26 4 1 0
27 5 2 0
28 17 1 0
29 6 1 0
30 28 1 0
31 28 2 0
32 29 1 0
33 32 1 0
13 23 2 0
14 24 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.60Molecular Weight (Monoisotopic): 491.1297AlogP: 0.79#Rotatable Bonds: 11Polar Surface Area: 175.29Molecular Species: BASEHBA: 7HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.11CX Basic pKa: 11.31CX LogP: 1.57CX LogD: 0.83Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.12Np Likeness Score: -0.71
References 1. Gabriel B, Stubbs MT, Bergner A, Hauptmann J, Bode W, Stürzebecher J, Moroder L.. (1998) Design of benzamidine-type inhibitors of factor Xa., 41 (22): [PMID:9784099 ] [10.1021/jm980227t ]