The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID49734717 ID: ALA1389935
PubChem CID: 24793599
Max Phase: Preclinical
Molecular Formula: C22H20N4O7S3
Molecular Weight: 548.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C2/C(=N)N3C(=NC2=O)SN=C3S(=O)(=O)C(C)C)ccc1OS(=O)(=O)c1ccccc1
Standard InChI: InChI=1S/C22H20N4O7S3/c1-13(2)35(28,29)22-25-34-21-24-20(27)16(19(23)26(21)22)11-14-9-10-17(18(12-14)32-3)33-36(30,31)15-7-5-4-6-8-15/h4-13,23H,1-3H3/b16-11-,23-19?
Standard InChI Key: GACGAYVSQYELNL-GJXXPDGXSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-5.9382 -1.3249 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.6832 0.7946 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.8172 0.5397 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.1535 -1.5798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7228 -1.0699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7552 0.9522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1027 0.9522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3262 1.7772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4047 -0.1748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2297 1.2542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8986 -0.2853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.1681 0.1272 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1841 0.9522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1841 -1.5228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.6832 -0.5403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8986 0.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1841 -0.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4697 -0.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4697 0.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1931 -2.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7552 -0.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0407 -0.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6118 0.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3262 0.9522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0407 0.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3262 -0.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6118 -0.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5316 0.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0001 -2.2810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6411 -2.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2461 0.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5316 -0.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9606 0.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2461 -1.1103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9606 -0.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0407 2.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 4 2 0
1 5 2 0
1 15 1 0
1 20 1 0
2 12 1 0
2 16 1 0
3 7 1 0
3 9 2 0
3 10 2 0
3 28 1 0
6 19 2 0
7 23 1 0
8 24 1 0
8 36 1 0
11 15 1 0
11 16 1 0
17 11 1 0
12 15 2 0
13 16 2 0
13 19 1 0
14 17 2 0
17 18 1 0
18 19 1 0
18 21 2 0
20 29 1 0
20 30 1 0
21 22 1 0
22 25 1 0
22 26 2 0
23 24 1 0
23 27 2 0
24 25 2 0
26 27 1 0
28 31 2 0
28 32 1 0
31 33 1 0
32 34 2 0
33 35 2 0
34 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.62Molecular Weight (Monoisotopic): 548.0494AlogP: 2.86#Rotatable Bonds: 6Polar Surface Area: 155.62Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.87CX LogD: 3.87Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.19
References 1. PubChem BioAssay data set,