The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{3-[3-(5-Ethyl-4'-fluoro-2-hydroxy-biphenyl-4-yloxy)-propoxy]-2-propyl-phenylsulfanyl}-benzoic acid ID: ALA139254
PubChem CID: 9872540
Max Phase: Preclinical
Molecular Formula: C33H33FO5S
Molecular Weight: 560.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1c(OCCCOc2cc(O)c(-c3ccc(F)cc3)cc2CC)cccc1Sc1ccccc1C(=O)O
Standard InChI: InChI=1S/C33H33FO5S/c1-3-9-25-29(11-7-13-31(25)40-32-12-6-5-10-26(32)33(36)37)38-18-8-19-39-30-21-28(35)27(20-22(30)4-2)23-14-16-24(34)17-15-23/h5-7,10-17,20-21,35H,3-4,8-9,18-19H2,1-2H3,(H,36,37)
Standard InChI Key: CAVSVHMDTRPSFI-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
10.6542 -5.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3375 -4.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2250 -5.8167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.9417 -5.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0542 -4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3375 -5.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5125 -5.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6542 -6.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8000 -5.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7750 -4.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7750 -5.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0542 -5.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6167 -4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0792 -5.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9375 -7.0542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0958 -4.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6167 -3.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0500 -3.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3667 -7.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8125 -3.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4917 -5.8292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0958 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8083 -4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5250 -2.9292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.3667 -5.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3625 -5.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5167 -4.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8000 -6.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9292 -5.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9417 -4.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7917 -4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0542 -6.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0750 -4.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2125 -5.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6417 -5.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5167 -7.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3667 -4.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7750 -7.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6542 -4.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5167 -7.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 2 0
3 4 1 0
4 1 1 0
5 10 2 0
6 12 1 0
7 3 1 0
8 1 1 0
9 7 1 0
10 11 1 0
11 21 1 0
12 11 2 0
13 2 1 0
14 9 2 0
15 8 2 0
16 13 1 0
17 13 2 0
18 5 1 0
19 8 1 0
20 22 2 0
21 34 1 0
22 17 1 0
23 16 2 0
24 20 1 0
25 1 2 0
26 14 1 0
27 7 2 0
28 9 1 0
29 35 1 0
30 4 2 0
31 27 1 0
32 12 1 0
33 31 2 0
34 29 1 0
35 26 1 0
36 28 1 0
37 25 1 0
38 32 1 0
39 37 2 0
40 36 1 0
39 30 1 0
14 33 1 0
5 2 1 0
23 20 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 560.69Molecular Weight (Monoisotopic): 560.2033AlogP: 8.41#Rotatable Bonds: 13Polar Surface Area: 75.99Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.32CX Basic pKa: ┄CX LogP: 9.21CX LogD: 5.79Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.16Np Likeness Score: -0.38
References 1. Sawyer JS, Bach NJ, Baker SR, Baldwin RF, Borromeo PS, Cockerham SL, Fleisch JH, Floreancig P, Froelich LL, Jackson WT.. (1995) Synthetic and structure/activity studies on acid-substituted 2-arylphenols: discovery of 2-[2-propyl-3-[3-[2-ethyl-4-(4-fluorophenyl)-5- hydroxyphenoxy]-propoxy]phenoxy]benzoic acid, a high-affinity leukotriene B4 receptor antagonist., 38 (22): [PMID:7473568 ] [10.1021/jm00022a006 ]