Thieno[2,3-b]pyrrolizin-8-one O-(2-diethylamino-ethyl)-oxime

ID: ALA140105

PubChem CID: 44360712

Max Phase: Preclinical

Molecular Formula: C15H19N3OS

Molecular Weight: 289.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCO/N=C1\c2sccc2-n2cccc21

Standard InChI:  InChI=1S/C15H19N3OS/c1-3-17(4-2)9-10-19-16-14-12-6-5-8-18(12)13-7-11-20-15(13)14/h5-8,11H,3-4,9-10H2,1-2H3/b16-14-

Standard InChI Key:  RMKNXTZRZSDIHT-PEZBUJJGSA-N

Molfile:  

     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
    3.9667   -1.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1667   -1.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2292   -0.5542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -1.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0042   -0.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6500   -2.5292    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.9167   -1.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6042   -2.1917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2750    0.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5250   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8750   -2.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0667    0.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1917   -2.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2542   -3.4875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0167   -2.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4292   -3.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3500   -2.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9125   -3.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1042   -2.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6667   -3.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4  2  2  0
  5  1  1  0
  6  2  1  0
  7  4  1  0
  8  1  2  0
  9  3  1  0
 10  5  2  0
 11  6  1  0
 12 10  1  0
 13  8  1  0
 14 16  1  0
 15 13  1  0
 16 15  1  0
 17 14  1  0
 18 14  1  0
 19 17  1  0
 20 18  1  0
  4  3  1  0
  9 12  2  0
 11  7  2  0
M  END

Associated Targets(Human)

HTR3A Tclin Serotonin 3 (5-HT3) receptor (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 289.40Molecular Weight (Monoisotopic): 289.1249AlogP: 2.96#Rotatable Bonds: 6
Polar Surface Area: 29.76Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.38CX LogP: 3.37CX LogD: 2.36
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.52Np Likeness Score: -1.57

References

1. Baglin I, Daveu C, Lancelot JC, Bureau R, Dauphin F, Pfeiffer B, Renard P, Delagrange P, Rault S..  (2001)  First tricyclic oximino derivatives as 5-HT3 ligands.,  11  (4): [PMID:11229746] [10.1016/s0960-894x(00)00691-0]

Source