The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-{4-[2-(2-Hydroxy-3-phenoxy-propylamino)-ethoxy]-phenoxy}-N-(2-methoxy-ethyl)-acetamide ID: ALA1409461
PubChem CID: 6604780
Max Phase: Preclinical
Molecular Formula: C22H30N2O6
Molecular Weight: 418.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCNC(=O)COc1ccc(OCCNC[C@@H](O)COc2ccccc2)cc1
Standard InChI: InChI=1S/C22H30N2O6/c1-27-13-12-24-22(26)17-30-21-9-7-20(8-10-21)28-14-11-23-15-18(25)16-29-19-5-3-2-4-6-19/h2-10,18,23,25H,11-17H2,1H3,(H,24,26)/t18-/m1/s1
Standard InChI Key: RVMBDLSFFNKKLG-GOSISDBHSA-N
Molfile:
RDKit 2D
30 31 0 0 1 0 0 0 0 0999 V2000
-5.4852 -0.8223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6273 0.8277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3740 0.4152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.9142 -1.6473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9450 -0.4098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.6286 -4.5348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.1997 -2.8848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4839 0.4152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7708 -0.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3418 0.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7708 0.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0563 -0.8223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0563 0.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3418 -0.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4852 -1.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0884 0.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1997 -2.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9129 0.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9450 0.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6595 0.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0884 1.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8029 0.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1984 0.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2305 0.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8029 2.0652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5174 0.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5174 1.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9142 -3.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9142 -4.1223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6286 -5.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 9 1 0
1 15 1 0
2 10 1 0
2 18 1 0
3 16 1 0
3 20 1 0
4 17 2 0
19 5 1 6
6 29 1 0
6 30 1 0
7 17 1 0
7 28 1 0
8 23 1 0
8 24 1 0
9 11 2 0
9 12 1 0
10 13 2 0
10 14 1 0
11 13 1 0
12 14 2 0
15 17 1 0
16 21 2 0
16 22 1 0
18 23 1 0
19 20 1 0
19 24 1 0
21 25 1 0
22 26 2 0
25 27 2 0
26 27 1 0
28 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.49Molecular Weight (Monoisotopic): 418.2104AlogP: 1.24#Rotatable Bonds: 15Polar Surface Area: 98.28Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.99CX Basic pKa: 8.79CX LogP: 1.15CX LogD: -0.24Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.37Np Likeness Score: -1.00
References 1. Howe R, Rao BS, Holloway BR, Stribling D.. (1992) Selective beta 3-adrenergic agonists of brown adipose tissue and thermogenesis. 2. [4-[2-[(2-Hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetamides., 35 (10): [PMID:1350310 ] [10.1021/jm00088a010 ] 2. PubChem BioAssay data set,