The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24790188 ID: ALA1417517
PubChem CID: 1102901
Max Phase: Preclinical
Molecular Formula: C26H14N2O6
Molecular Weight: 450.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1ccc(O)cc1)C(=O)N(c1ccc(O)cc1)C3=O
Standard InChI: InChI=1S/C26H14N2O6/c29-15-5-1-13(2-6-15)27-23(31)17-9-11-19-22-20(12-10-18(21(17)22)24(27)32)26(34)28(25(19)33)14-3-7-16(30)8-4-14/h1-12,29-30H
Standard InChI Key: PVIYUMMXACSJDP-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
2.0185 -1.2343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0185 1.6236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1065 -1.2343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1065 1.6236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3185 0.1947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.4065 0.1947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0185 0.1947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1065 0.1947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3685 0.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4565 0.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7810 -0.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7810 0.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8690 -0.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8690 0.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6060 -0.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6060 0.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6940 -0.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6940 0.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3685 -1.2343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3685 1.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4565 -1.2343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4565 1.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8435 0.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9315 0.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2560 0.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3440 -0.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2560 -0.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3440 0.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0810 0.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1690 -0.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0810 -0.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1690 0.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4935 0.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5815 0.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 15 2 0
2 16 2 0
3 17 2 0
4 18 2 0
5 33 1 0
6 34 1 0
7 15 1 0
7 16 1 0
7 23 1 0
8 17 1 0
8 18 1 0
8 24 1 0
9 10 2 0
9 11 1 0
9 12 1 0
10 13 1 0
10 14 1 0
11 15 1 0
11 19 2 0
12 16 1 0
12 20 2 0
13 17 1 0
13 21 2 0
14 18 1 0
14 22 2 0
19 21 1 0
20 22 1 0
23 25 2 0
23 27 1 0
24 26 2 0
24 28 1 0
25 29 1 0
26 30 1 0
27 31 2 0
28 32 2 0
29 33 2 0
30 34 2 0
31 33 1 0
32 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.41Molecular Weight (Monoisotopic): 450.0852AlogP: 3.85#Rotatable Bonds: 2Polar Surface Area: 115.22Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.68CX Basic pKa: ┄CX LogP: 3.56CX LogD: 3.54Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -0.21
References 1. PubChem BioAssay data set,