The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24405075 ID: ALA1417607
PubChem CID: 16026618
Max Phase: Preclinical
Molecular Formula: C26H28N4O2
Molecular Weight: 428.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCn1nc(C)c2c(-c3ccccc3)cc(=O)n(C(C)C(=O)NCc3ccc(C)cc3)c21
Standard InChI: InChI=1S/C26H28N4O2/c1-5-29-26-24(18(3)28-29)22(21-9-7-6-8-10-21)15-23(31)30(26)19(4)25(32)27-16-20-13-11-17(2)12-14-20/h6-15,19H,5,16H2,1-4H3,(H,27,32)
Standard InChI Key: ZODPKUHZYJFTOL-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-0.6124 0.3204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6124 -0.5046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0414 0.3204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5405 0.4780 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0254 1.1454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3269 -1.7421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7559 0.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7559 1.5579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0414 1.9704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5405 1.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3269 0.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3269 1.5579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0414 -0.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0414 2.7954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7954 -0.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3269 -0.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7954 2.5975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7559 3.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3269 3.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7559 -0.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7559 4.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3269 4.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2434 -0.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0414 4.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6124 -2.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6124 -2.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1020 -3.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3269 -3.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6124 -4.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1020 -4.2171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3269 -4.2171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6124 -5.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 11 2 0
2 16 2 0
3 7 1 0
3 11 1 0
3 13 1 0
4 5 1 0
4 7 1 0
4 15 1 0
5 10 2 0
6 16 1 0
6 25 1 0
7 8 2 0
8 9 1 0
8 10 1 0
9 12 2 0
9 14 1 0
10 17 1 0
11 12 1 0
13 16 1 0
13 20 1 0
14 18 2 0
14 19 1 0
15 23 1 0
18 21 1 0
19 22 2 0
21 24 2 0
22 24 1 0
25 26 1 0
26 27 2 0
26 28 1 0
27 30 1 0
28 31 2 0
29 30 2 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.54Molecular Weight (Monoisotopic): 428.2212AlogP: 4.38#Rotatable Bonds: 6Polar Surface Area: 68.92Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.00CX LogP: 3.60CX LogD: 3.60Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -1.36
References 1. PubChem BioAssay data set,