2-[4-(2,2,3,3,4,4,4-Heptafluoro-butoxy)-3-methyl-pyridin-2-ylmethanesulfinyl]-3H-thieno[3,4-d]imidazole

ID: ALA141803

PubChem CID: 15133685

Max Phase: Preclinical

Molecular Formula: C16H12F7N3O2S2

Molecular Weight: 475.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(OCC(F)(F)C(F)(F)C(F)(F)F)ccnc1C[S+]([O-])c1nc2cscc2[nH]1

Standard InChI:  InChI=1S/C16H12F7N3O2S2/c1-8-11(6-30(27)13-25-9-4-29-5-10(9)26-13)24-3-2-12(8)28-7-14(17,18)15(19,20)16(21,22)23/h2-5H,6-7H2,1H3,(H,25,26)

Standard InChI Key:  CWKGGZFYHLURKH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    5.1889   -3.2159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4712   -2.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5652   -3.9615    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7802   -2.6326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6542   -2.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3820   -3.8281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5167   -3.0131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2253   -2.1553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3689   -3.0846    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.9474   -2.8401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5880   -3.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1746   -3.1306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7016   -3.6238    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.1192   -4.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3319   -2.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0952   -2.0232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1193   -2.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5408   -2.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7606   -2.8917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5168   -2.2676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2847   -1.6907    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0073   -3.1407    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7979   -3.4746    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7344   -1.8286    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2923   -1.3250    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8999   -2.6340    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6891   -1.5237    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.4580   -1.4945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6778   -1.7794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0392   -3.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  0
  3  1  2  0
  4  1  1  0
  5 17  1  0
  6  3  1  0
  7  4  1  0
  8  2  1  0
  9  1  1  0
 10 11  1  0
 11  9  1  0
 12 10  1  0
 13 15  1  0
 14  6  2  0
 15  7  2  0
 16 10  2  0
 17 19  1  0
 18 12  2  0
 19 18  1  0
 20  9  1  0
 21  2  1  0
 22  2  1  0
 23  5  1  0
 24  5  1  0
 25  8  1  0
 26  8  1  0
 27  8  1  0
 28 16  1  0
 29 28  2  0
 30 12  1  0
  7  6  1  0
 14 13  1  0
 29 18  1  0
M  CHG  2   9   1  20  -1
M  END

Associated Targets(non-human)

Atp4a Potassium-transporting ATPase (425 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 475.41Molecular Weight (Monoisotopic): 475.0259AlogP: 4.85#Rotatable Bonds: 7
Polar Surface Area: 73.86Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.23CX Basic pKa: 4.19CX LogP: 4.21CX LogD: 4.16
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -0.62

References

1. Weidmann K, Herling AW, Lang HJ, Scheunemann KH, Rippel R, Nimmesgern H, Scholl T, Bickel M, Metzger H..  (1992)  2-[(2-pyridylmethyl)sulfinyl]-1H-thieno[3,4-d]imidazoles. A novel class of gastric H+/K(+)-ATPase inhibitors.,  35  (3): [PMID:1310742] [10.1021/jm00081a004]

Source