The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24830336 ID: ALA1433074
PubChem CID: 2317063
Max Phase: Preclinical
Molecular Formula: C24H23N3O2S
Molecular Weight: 417.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCOc1ccc(-c2c(C#N)c(S)nc(C)c2C(=O)Nc2ccccc2)cc1
Standard InChI: InChI=1S/C24H23N3O2S/c1-3-4-14-29-19-12-10-17(11-13-19)22-20(15-25)24(30)26-16(2)21(22)23(28)27-18-8-6-5-7-9-18/h5-13H,3-4,14H2,1-2H3,(H,26,30)(H,27,28)
Standard InChI Key: NRIWBQWXWMBSOW-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
-1.9991 -3.4659 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.2847 0.2466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5732 0.2466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7136 -2.2284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7136 0.2466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1443 -3.0534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2847 -1.4034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9991 -0.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2847 -2.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5702 -0.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7136 -1.4034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9991 -2.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9991 -0.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5702 -0.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1443 -1.4034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5702 -2.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4281 -0.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8587 -0.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1443 0.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8587 -0.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7136 1.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4281 1.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9991 1.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4281 2.3091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9991 2.3091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2877 -0.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7136 2.7216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0022 0.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7166 -0.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4311 0.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 12 1 0
2 13 2 0
3 18 1 0
3 26 1 0
4 11 1 0
4 12 2 0
5 13 1 0
5 21 1 0
6 16 3 0
7 8 1 0
7 9 2 0
7 10 1 0
8 11 2 0
8 13 1 0
9 12 1 0
9 16 1 0
10 14 2 0
10 15 1 0
11 17 1 0
14 19 1 0
15 20 2 0
18 19 2 0
18 20 1 0
21 22 2 0
21 23 1 0
22 24 1 0
23 25 2 0
24 27 2 0
25 27 1 0
26 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.53Molecular Weight (Monoisotopic): 417.1511AlogP: 5.65#Rotatable Bonds: 7Polar Surface Area: 75.01Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.38CX Basic pKa: ┄CX LogP: 5.34CX LogD: 5.04Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: -1.32
References 1. PubChem BioAssay data set,