The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID56317263 ID: ALA1436090
PubChem CID: 24687447
Max Phase: Preclinical
Molecular Formula: C20H29N5O7S2
Molecular Weight: 515.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCn1c(N)c(N(CCOC)C(=O)Cc2ccc(S(=O)(=O)N3CCOCC3)s2)c(=O)[nH]c1=O
Standard InChI: InChI=1S/C20H29N5O7S2/c1-3-6-25-18(21)17(19(27)22-20(25)28)24(9-10-31-2)15(26)13-14-4-5-16(33-14)34(29,30)23-7-11-32-12-8-23/h4-5H,3,6-13,21H2,1-2H3,(H,22,27,28)
Standard InChI Key: ULBXGWVLZPZFJY-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
0.5479 4.4925 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.5946 3.5673 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.2057 4.8280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3016 4.1569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6808 0.2718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6808 1.0968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1098 -2.2032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5546 6.7535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5387 2.7468 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1098 1.0968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8835 5.2462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8242 -0.9657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3953 -0.9657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5387 0.2718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1098 0.2718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2124 3.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8242 -0.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3953 -0.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6808 2.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3953 1.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1098 -1.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6249 3.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3953 2.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0729 2.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8242 1.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7040 5.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3986 5.9136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5387 -1.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0395 6.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7341 6.6673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8242 2.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2532 -0.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9676 -1.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5387 3.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 2 0
1 4 2 0
1 11 1 0
1 16 1 0
2 16 1 0
2 19 1 0
5 18 2 0
6 20 2 0
7 21 2 0
8 29 1 0
8 30 1 0
9 31 1 0
9 34 1 0
10 15 1 0
10 20 1 0
10 25 1 0
11 26 1 0
11 27 1 0
12 17 1 0
12 21 1 0
12 28 1 0
13 18 1 0
13 21 1 0
14 17 1 0
15 17 2 0
15 18 1 0
16 22 2 0
19 23 1 0
19 24 2 0
20 23 1 0
22 24 1 0
25 31 1 0
26 29 1 0
27 30 1 0
28 32 1 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.61Molecular Weight (Monoisotopic): 515.1508AlogP: -0.17#Rotatable Bonds: 10Polar Surface Area: 157.03Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.20CX Basic pKa: ┄CX LogP: -0.39CX LogD: -0.40Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -2.43
References 1. PubChem BioAssay data set,