The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID49679409 ID: ALA1438889
PubChem CID: 1587127
Max Phase: Preclinical
Molecular Formula: C22H20N2O6S2
Molecular Weight: 472.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C2\SC(=S)N(CCC(=O)Nc3ccc(C(=O)O)cc3)C2=O)cc1OC
Standard InChI: InChI=1S/C22H20N2O6S2/c1-29-16-8-3-13(11-17(16)30-2)12-18-20(26)24(22(31)32-18)10-9-19(25)23-15-6-4-14(5-7-15)21(27)28/h3-8,11-12H,9-10H2,1-2H3,(H,23,25)(H,27,28)/b18-12-
Standard InChI Key: SXQHJEJEQMJASD-PDGQHHTCSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-2.2623 1.2166 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6824 1.5972 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.2303 -0.9179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7306 3.2582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9104 3.0857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2989 -1.0129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.5857 -1.0129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.8713 -2.2504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1555 0.2246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.0134 0.2246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8498 0.5022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4018 -0.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0693 1.0451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0293 0.4159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5444 1.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8700 -0.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3950 2.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8800 1.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4255 2.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2761 0.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5844 0.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7610 1.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2989 -0.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7279 -0.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1568 -1.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7279 -1.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4423 0.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4423 -1.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1568 -0.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8713 -1.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2457 3.9256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5748 3.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 11 1 0
1 13 1 0
2 13 2 0
3 12 2 0
4 17 1 0
4 31 1 0
5 19 1 0
5 32 1 0
6 23 2 0
7 30 2 0
8 30 1 0
9 12 1 0
9 13 1 0
9 16 1 0
10 23 1 0
10 24 1 0
11 12 1 0
11 14 2 0
14 15 1 0
15 18 1 0
15 20 2 0
16 21 1 0
17 18 2 0
17 19 1 0
19 22 2 0
20 22 1 0
21 23 1 0
24 26 2 0
24 27 1 0
25 28 2 0
25 29 1 0
25 30 1 0
26 28 1 0
27 29 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.54Molecular Weight (Monoisotopic): 472.0763AlogP: 3.63#Rotatable Bonds: 8Polar Surface Area: 105.17Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.16CX Basic pKa: ┄CX LogP: 3.46CX LogD: 0.40Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -1.50
References 1. PubChem BioAssay data set, 2. PubChem BioAssay data set,