The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID14732018 ID: ALA1440794
PubChem CID: 2903347
Max Phase: Preclinical
Molecular Formula: C25H34N2O5
Molecular Weight: 442.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CN2CCC(C(=O)NCCc3ccc(OC)c(OC)c3)CC2)c(OC)c1
Standard InChI: InChI=1S/C25H34N2O5/c1-29-21-7-6-20(23(16-21)31-3)17-27-13-10-19(11-14-27)25(28)26-12-9-18-5-8-22(30-2)24(15-18)32-4/h5-8,15-16,19H,9-14,17H2,1-4H3,(H,26,28)
Standard InChI Key: YSVMFHHFPYTTLR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-3.1308 3.3203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.9887 3.3203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7284 3.7328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7284 2.0828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2729 2.4953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4163 4.5578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4416 3.7328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8452 4.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8452 3.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1308 4.9703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9874 3.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2742 3.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5597 3.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5597 4.9703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0139 3.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0139 2.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5850 3.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7018 4.9703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4163 3.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2729 3.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2742 4.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9874 4.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7018 3.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2995 3.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2995 2.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5850 2.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8705 3.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1560 3.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1308 2.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7284 4.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7031 3.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4429 2.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 9 1 0
1 29 1 0
2 12 1 0
2 31 1 0
3 15 1 0
3 30 1 0
4 16 1 0
4 32 1 0
5 20 2 0
6 10 1 0
6 18 1 0
6 19 1 0
7 20 1 0
7 28 1 0
8 9 1 0
8 10 1 0
8 14 2 0
9 13 2 0
11 20 1 0
11 22 1 0
11 23 1 0
12 13 1 0
12 21 2 0
14 21 1 0
15 16 1 0
15 24 2 0
16 25 2 0
17 24 1 0
17 26 2 0
17 27 1 0
18 22 1 0
19 23 1 0
25 26 1 0
27 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.56Molecular Weight (Monoisotopic): 442.2468AlogP: 3.29#Rotatable Bonds: 10Polar Surface Area: 69.26Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.94CX LogP: 2.79CX LogD: 2.14Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -0.95
References 1. PubChem BioAssay data set,