The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24387464 ID: ALA1444513
PubChem CID: 16010905
Max Phase: Preclinical
Molecular Formula: C27H34N4O2S
Molecular Weight: 478.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c(C(=O)N2CCCC(C(=O)N3CCN(c4cc(C)ccc4C)CC3)C2)cc2sccc21
Standard InChI: InChI=1S/C27H34N4O2S/c1-4-31-22-9-15-34-25(22)17-24(31)27(33)30-10-5-6-21(18-30)26(32)29-13-11-28(12-14-29)23-16-19(2)7-8-20(23)3/h7-9,15-17,21H,4-6,10-14,18H2,1-3H3
Standard InChI Key: XSSDSUNYWITEPW-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
4.4546 -1.5852 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.1629 -1.6323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3121 -0.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8853 -0.2504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1629 -0.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3121 1.2256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1371 2.6545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4004 -0.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6700 -0.5053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6700 -1.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5754 -0.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8853 -1.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4546 -0.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0746 0.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6304 0.5343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3379 -0.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9395 -0.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8996 0.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5754 0.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5496 3.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3379 1.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1629 1.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1371 1.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8996 1.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5496 1.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3121 2.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3746 3.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1371 4.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1824 1.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5496 4.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7871 4.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3746 4.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7871 2.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1371 5.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 10 1 0
1 17 1 0
2 11 2 0
3 18 2 0
4 8 1 0
4 9 1 0
4 15 1 0
5 11 1 0
5 16 1 0
5 19 1 0
6 18 1 0
6 23 1 0
6 24 1 0
7 20 1 0
7 25 1 0
7 26 1 0
8 11 1 0
8 12 2 0
9 10 2 0
9 13 1 0
10 12 1 0
13 17 2 0
14 16 1 0
14 18 1 0
14 21 1 0
15 29 1 0
19 22 1 0
20 27 2 0
20 28 1 0
21 22 1 0
23 25 1 0
24 26 1 0
27 31 1 0
27 33 1 0
28 30 2 0
30 32 1 0
30 34 1 0
31 32 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.66Molecular Weight (Monoisotopic): 478.2402AlogP: 4.54#Rotatable Bonds: 4Polar Surface Area: 48.79Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.77CX LogP: 4.39CX LogD: 4.39Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.55Np Likeness Score: -2.14
References 1. PubChem BioAssay data set,