The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24402349 ID: ALA1444552
PubChem CID: 16023949
Max Phase: Preclinical
Molecular Formula: C25H33FN4O3
Molecular Weight: 456.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)N1CCC(c2c(C(=O)N3CCCCC3)cnn2-c2cccc(F)c2)CC1
Standard InChI: InChI=1S/C25H33FN4O3/c1-25(2,3)33-24(32)29-14-10-18(11-15-29)22-21(23(31)28-12-5-4-6-13-28)17-27-30(22)20-9-7-8-19(26)16-20/h7-9,16-18H,4-6,10-15H2,1-3H3
Standard InChI Key: ZGXDDLSPDIYNFE-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
5.9219 0.4901 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.6329 -3.8356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3734 -0.6431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9318 -2.0021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3508 -1.9849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0183 -2.4698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7889 -4.6755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3295 -1.7050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6834 -2.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9383 -3.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8988 -2.2149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3508 -1.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4534 -3.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7633 -3.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7272 -1.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2857 -2.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6363 -0.7474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0653 -0.7474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9426 -1.1530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5010 -2.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6363 0.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5449 -1.4501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6094 -4.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3040 -5.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0653 0.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3508 0.4901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9450 -5.5155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6396 -6.0967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5887 -0.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4601 -6.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8041 -0.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8437 0.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3338 -1.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 21 1 0
2 13 2 0
3 22 1 0
3 29 1 0
4 22 2 0
5 6 1 0
5 9 1 0
5 12 1 0
6 14 2 0
7 13 1 0
7 23 1 0
7 24 1 0
8 19 1 0
8 20 1 0
8 22 1 0
9 10 2 0
9 11 1 0
10 13 1 0
10 14 1 0
11 15 1 0
11 16 1 0
12 17 2 0
12 18 1 0
15 19 1 0
16 20 1 0
17 21 1 0
18 25 2 0
21 26 2 0
23 27 1 0
24 28 1 0
25 26 1 0
27 30 1 0
28 30 1 0
29 31 1 0
29 32 1 0
29 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.56Molecular Weight (Monoisotopic): 456.2537AlogP: 4.75#Rotatable Bonds: 3Polar Surface Area: 67.67Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.49CX LogP: 3.58CX LogD: 3.58Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.67Np Likeness Score: -1.86
References 1. PubChem BioAssay data set,