N-(3-Pyridin-2-yl-isoquinolin-1-yl)-pyrazine-2-carboxamidine

ID: ALA144732

PubChem CID: 44363871

Max Phase: Preclinical

Molecular Formula: C19H14N6

Molecular Weight: 326.36

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N=C(Nc1nc(-c2ccccn2)cc2ccccc12)c1cnccn1

Standard InChI:  InChI=1S/C19H14N6/c20-18(17-12-21-9-10-23-17)25-19-14-6-2-1-5-13(14)11-16(24-19)15-7-3-4-8-22-15/h1-12H,(H2,20,24,25)

Standard InChI Key:  TYTPSCRYPYNZCL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
    4.7042   -4.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7042   -5.5500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4250   -4.3125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4250   -5.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4250   -3.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4250   -6.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9917   -4.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7042   -3.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9917   -3.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1375   -7.1917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1292   -3.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8500   -3.4792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7042   -8.0167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1375   -5.5500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7042   -7.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2792   -3.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1417   -8.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2792   -4.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4250   -8.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5625   -3.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1292   -2.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5667   -3.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5542   -2.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5667   -4.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8375   -1.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  2  0
  4  2  1  0
  5  3  1  0
  6  4  1  0
  7  1  1  0
  8  9  1  0
  9  7  2  0
 10  6  2  0
 11  5  1  0
 12 11  2  0
 13 15  2  0
 14  4  2  0
 15  6  1  0
 16  9  1  0
 17 10  1  0
 18  7  1  0
 19 13  1  0
 20 12  1  0
 21 11  1  0
 22 24  1  0
 23 25  1  0
 24 18  2  0
 25 21  2  0
  8  5  2  0
 22 16  2  0
 23 20  2  0
 17 19  2  0
M  END

Associated Targets(non-human)

Mycoplasmoides gallisepticum (165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 326.36Molecular Weight (Monoisotopic): 326.1280AlogP: 3.52#Rotatable Bonds: 3
Polar Surface Area: 87.44Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.15CX LogP: 2.60CX LogD: 2.60
Aromatic Rings: 4Heavy Atoms: 25QED Weighted: 0.44Np Likeness Score: -0.90

References

1. de Zwart MA, van der Goot H, Timmerman H..  (1989)  Synthesis and copper-dependent antimycoplasmal activity of 1-amino-3-(2-pyridyl)isoquinoline derivatives. 2. Amidines.,  32  (2): [PMID:2913309] [10.1021/jm00122a033]

Source