1-{2-[3-(2,2-Diphenyl-ethylamino)-2-hydroxy-propoxy]-phenyl}-3-phenyl-propan-1-one

ID: ALA145861

PubChem CID: 44364497

Max Phase: Preclinical

Molecular Formula: C32H33NO3

Molecular Weight: 479.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCc1ccccc1)c1ccccc1OCC(O)CNCC(c1ccccc1)c1ccccc1

Standard InChI:  InChI=1S/C32H33NO3/c34-28(22-33-23-30(26-14-6-2-7-15-26)27-16-8-3-9-17-27)24-36-32-19-11-10-18-29(32)31(35)21-20-25-12-4-1-5-13-25/h1-19,28,30,33-34H,20-24H2

Standard InChI Key:  FMIVAZYAYOFSEE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    3.2542   -1.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9667   -1.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -0.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2542    0.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9667    0.2208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6792   -1.0250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9667   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667   -0.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2542    1.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8250    0.2333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6792   -0.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3917    0.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6875   -2.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6875   -3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5375   -0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3917    1.0458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5375   -1.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1125   -0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5375    0.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667    1.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5375    1.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667   -1.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6792    0.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -3.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -3.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8250   -1.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8250   -0.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667    2.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6792   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3917   -0.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5375    2.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -4.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9792   -4.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3917   -1.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -5.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2542    2.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4 15  1  0
  5  3  1  0
  6  2  2  0
  7  2  1  0
  8  4  1  0
  9  4  1  0
 10 18  1  0
 11  5  1  0
 12 11  1  0
 13  7  1  0
 14 13  1  0
 15 10  1  0
 16 12  1  0
 17  1  2  0
 18 12  1  0
 19  3  2  0
 20  9  2  0
 21  9  1  0
 22  8  2  0
 23  8  1  0
 24 14  2  0
 25 14  1  0
 26 17  1  0
 27 26  2  0
 28 20  1  0
 29 22  1  0
 30 23  2  0
 31 21  2  0
 32 25  2  0
 33 24  1  0
 34 30  1  0
 35 32  1  0
 36 31  1  0
 27 19  1  0
 35 33  2  0
 36 28  2  0
 34 29  2  0
M  END

Associated Targets(Human)

CCRF-CEM/VCR-1000 (82 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.62Molecular Weight (Monoisotopic): 479.2460AlogP: 5.66#Rotatable Bonds: 13
Polar Surface Area: 58.56Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.37CX LogP: 6.17CX LogD: 4.22
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -0.29

References

1. Fleischer R, Wiese M..  (2003)  Three-dimensional quantitative structure-activity relationship analysis of propafenone-type multidrug resistance modulators: influence of variable selection on test set predictivity.,  46  (23): [PMID:14584949] [10.1021/jm030876r]
2. Kaiser D, Terfloth L, Kopp S, Schulz J, de Laet R, Chiba P, Ecker GF, Gasteiger J..  (2007)  Self-organizing maps for identification of new inhibitors of P-glycoprotein.,  50  (7): [PMID:17352460] [10.1021/jm060604z]

Source