1-(3-{3-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-2-hydroxy-propoxy}-phenyl)-3-phenyl-propan-1-one

ID: ALA146084

PubChem CID: 11225024

Max Phase: Preclinical

Molecular Formula: C28H31FN2O3

Molecular Weight: 462.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCc1ccccc1)c1cccc(OCC(O)CN2CCN(c3ccc(F)cc3)CC2)c1

Standard InChI:  InChI=1S/C28H31FN2O3/c29-24-10-12-25(13-11-24)31-17-15-30(16-18-31)20-26(32)21-34-27-8-4-7-23(19-27)28(33)14-9-22-5-2-1-3-6-22/h1-8,10-13,19,26,32H,9,14-18,20-21H2

Standard InChI Key:  YKPBKGMQMVWAGB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    9.0542    0.8083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6292   -0.0125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7667    1.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3417   -2.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3417   -1.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0542   -0.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3417    1.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0542   -1.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0542   -2.9167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6292   -2.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9167   -0.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4792    0.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7667    2.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3417   -0.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6167    0.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7667   -0.0250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2000   -0.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0542   -0.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1917    2.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4875   -0.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6292   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4792    2.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1917    1.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9125    2.4583    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.1917    0.8083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9125   -4.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6292   -1.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6292   -0.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3417   -0.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9167   -4.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2000   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4875   -4.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2042   -5.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4875   -4.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 15  1  0
  3  1  1  0
  4  5  1  0
  5  8  2  0
  6  1  1  0
  7  1  1  0
  8 18  1  0
  9  4  2  0
 10  4  1  0
 11  2  1  0
 12  3  2  0
 13  3  1  0
 14  6  1  0
 15  7  1  0
 16 20  1  0
 17 11  1  0
 18 16  1  0
 19 22  1  0
 20 17  1  0
 21 10  1  0
 22 13  2  0
 23 12  1  0
 24 19  1  0
 25 17  1  0
 26 21  1  0
 27 28  2  0
 28 29  1  0
 29 18  2  0
 30 26  1  0
 31 26  2  0
 32 31  1  0
 33 30  2  0
 34 32  2  0
 14  2  1  0
 19 23  2  0
  5 27  1  0
 34 33  1  0
M  END

Associated Targets(Human)

CCRF-CEM/VCR-1000 (82 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.57Molecular Weight (Monoisotopic): 462.2319AlogP: 4.20#Rotatable Bonds: 10
Polar Surface Area: 53.01Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.65CX LogP: 4.92CX LogD: 4.85
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.21

References

1. Fleischer R, Wiese M..  (2003)  Three-dimensional quantitative structure-activity relationship analysis of propafenone-type multidrug resistance modulators: influence of variable selection on test set predictivity.,  46  (23): [PMID:14584949] [10.1021/jm030876r]
2. Kaiser D, Terfloth L, Kopp S, Schulz J, de Laet R, Chiba P, Ecker GF, Gasteiger J..  (2007)  Self-organizing maps for identification of new inhibitors of P-glycoprotein.,  50  (7): [PMID:17352460] [10.1021/jm060604z]

Source