1-[1-(1-Phenyl-1H-pyrrol-3-ylmethyl)-piperidin-4-yl]-1,3-dihydro-benzoimidazol-2-one

ID: ALA146557

PubChem CID: 10761828

Max Phase: Preclinical

Molecular Formula: C23H24N4O

Molecular Weight: 372.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1nc2ccccc2n1C1CCN(Cc2ccn(-c3ccccc3)c2)CC1

Standard InChI:  InChI=1S/C23H24N4O/c28-23-24-21-8-4-5-9-22(21)27(23)20-11-13-25(14-12-20)16-18-10-15-26(17-18)19-6-2-1-3-7-19/h1-10,15,17,20H,11-14,16H2,(H,24,28)

Standard InChI Key:  DZKGMYCNIICGIS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
    7.1917   -3.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3875   -3.6792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2792   -4.6750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9167   -0.8625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9792   -4.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2167   -0.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6667   -1.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5250   -5.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0000   -0.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0500   -2.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8042    0.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3792   -1.4167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8042   -3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2292   -2.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5375   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0417   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2042   -1.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8917   -2.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1750   -4.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2750   -5.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4917   -0.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2042   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9167   -5.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4750   -5.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7792   -1.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4917   -2.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7792   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  2  0
  4  7  1  0
  5  2  1  0
  6 16  1  0
  7  6  2  0
  8  3  1  0
  9 11  2  0
 10  2  1  0
 11  6  1  0
 12 19  1  0
 13  1  1  0
 14 10  1  0
 15 10  1  0
 16 12  1  0
 17  4  1  0
 18 14  1  0
 19 15  1  0
 20  5  2  0
 21  8  2  0
 22 17  2  0
 23 17  1  0
 24 20  1  0
 25 21  1  0
 26 22  1  0
 27 23  2  0
 28 27  1  0
  8  5  1  0
 24 25  2  0
 12 18  1  0
  9  4  1  0
 26 28  2  0
M  END

Associated Targets(Human)

DRD4 Tchem Dopamine D4 receptor (7907 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

DRD2 Dopamine D2 receptor (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DRD3 Dopamine D3 receptor (16 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 372.47Molecular Weight (Monoisotopic): 372.1950AlogP: 4.37#Rotatable Bonds: 4
Polar Surface Area: 46.22Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.66CX Basic pKa: 8.42CX LogP: 4.58CX LogD: 3.52
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.58Np Likeness Score: -1.35

References

1. Thurkauf A, Yuan J, Chen X, Wasley JW, Meade R, Woodruff KH, Huston K, Ross PC..  (1995)  1-Phenyl-3-(aminomethyl)pyrroles as potential antipsychotic agents. Synthesis and dopamine receptor binding.,  38  (25): [PMID:8523409] [10.1021/jm00025a013]

Source