The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID7973945 ID: ALA1468109
Cas Number: 636988-29-9
PubChem CID: 5737428
Max Phase: Preclinical
Molecular Formula: C22H23ClN2O4
Molecular Weight: 414.89
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)C2=C(O)C(=O)N(CCN(C)C)C2c2ccccc2)cc1Cl
Standard InChI: InChI=1S/C22H23ClN2O4/c1-24(2)11-12-25-19(14-7-5-4-6-8-14)18(21(27)22(25)28)20(26)15-9-10-17(29-3)16(23)13-15/h4-10,13,19,27H,11-12H2,1-3H3
Standard InChI Key: KDCMMDSMXDJZQG-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
0.5845 -1.9551 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5090 0.8871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0637 2.5941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1063 0.9734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0564 -2.1276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6116 2.8241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3261 4.8866 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1991 1.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0558 2.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0241 1.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2790 2.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2858 0.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8405 2.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0497 0.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6116 3.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0120 3.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4536 2.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4352 -0.5340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8702 0.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0996 -1.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7209 -1.3739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2058 -0.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3261 4.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7966 3.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2382 2.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4097 3.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0405 5.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6116 5.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5715 -2.7950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 20 1 0
2 10 1 0
3 11 2 0
4 12 2 0
5 21 1 0
5 29 1 0
6 9 1 0
6 11 1 0
6 15 1 0
7 23 1 0
7 27 1 0
7 28 1 0
8 9 1 0
8 10 2 0
8 12 1 0
9 13 1 0
10 11 1 0
12 14 1 0
13 16 2 0
13 17 1 0
14 18 1 0
14 19 2 0
15 23 1 0
16 24 1 0
17 25 2 0
18 20 2 0
19 22 1 0
20 21 1 0
21 22 2 0
24 26 2 0
25 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.89Molecular Weight (Monoisotopic): 414.1346AlogP: 3.49#Rotatable Bonds: 7Polar Surface Area: 70.08Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.52CX Basic pKa: 7.76CX LogP: 2.58CX LogD: 2.20Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.70Np Likeness Score: -1.29
References 1. PubChem BioAssay data set,