The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24841587 ID: ALA1470884
PubChem CID: 16197076
Max Phase: Preclinical
Molecular Formula: C23H26BrNO4
Molecular Weight: 460.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCO[C@@H]1OC(C(=O)Nc2ccccc2)=C[C@H](c2ccc(Br)cc2)[C@H]1CCCO
Standard InChI: InChI=1S/C23H26BrNO4/c1-2-28-23-19(9-6-14-26)20(16-10-12-17(24)13-11-16)15-21(29-23)22(27)25-18-7-4-3-5-8-18/h3-5,7-8,10-13,15,19-20,23,26H,2,6,9,14H2,1H3,(H,25,27)/t19-,20-,23-/m1/s1
Standard InChI Key: BFJMLSQDUXDYEI-TXTKFYIRSA-N
Molfile:
RDKit 2D
29 31 0 0 1 0 0 0 0 0999 V2000
-3.8205 -2.1415 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
0.4663 0.3335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1808 -0.9040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4663 1.9835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8953 -2.1415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9626 1.9835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9626 -0.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2481 -0.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4663 -0.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2481 0.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6771 -0.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9626 0.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2481 1.5710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2481 -1.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6771 -1.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3915 -0.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3915 -2.1415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1060 -0.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1060 -1.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9626 2.8085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4663 -2.1415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8953 -0.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6771 3.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2481 3.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1808 -1.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6771 4.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2481 4.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6097 -0.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9626 4.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 19 1 0
2 9 1 0
2 10 1 0
9 3 1 1
3 22 1 0
4 13 2 0
5 25 1 0
6 13 1 0
6 20 1 0
7 8 1 0
7 11 1 1
7 12 1 0
8 9 1 0
8 14 1 6
10 12 2 0
10 13 1 0
11 15 2 0
11 16 1 0
14 21 1 0
15 17 1 0
16 18 2 0
17 19 2 0
18 19 1 0
20 23 2 0
20 24 1 0
21 25 1 0
22 28 1 0
23 26 1 0
24 27 2 0
26 29 2 0
27 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.37Molecular Weight (Monoisotopic): 459.1045AlogP: 4.84#Rotatable Bonds: 8Polar Surface Area: 67.79Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.63CX Basic pKa: ┄CX LogP: 4.45CX LogD: 4.45Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: 0.09
References 1. PubChem BioAssay data set,