The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-{3-[4-(6-Fluoro-benzo[d]isoxazol-3-yl)-piperidin-1-yl]-propylamino}-3-methoxy-phenyl)-ethanone ID: ALA14727
PubChem CID: 10387699
Max Phase: Preclinical
Molecular Formula: C24H28FN3O3
Molecular Weight: 425.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(C)=O)ccc1NCCCN1CCC(c2noc3cc(F)ccc23)CC1
Standard InChI: InChI=1S/C24H28FN3O3/c1-16(29)18-4-7-21(23(14-18)30-2)26-10-3-11-28-12-8-17(9-13-28)24-20-6-5-19(25)15-22(20)31-27-24/h4-7,14-15,17,26H,3,8-13H2,1-2H3
Standard InChI Key: MDVOAKSPEFVXPL-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
1.4792 -13.9000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4792 -13.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0500 -13.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7625 -14.3125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0417 -13.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7625 -8.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2375 -11.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6708 -12.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6708 -14.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9625 -8.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3792 -9.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0667 -12.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3417 -8.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5917 -10.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9667 -9.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1375 -7.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3792 -10.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3833 -13.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8625 -12.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8542 -11.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4417 -11.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4417 -12.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0042 -10.6042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3833 -13.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5792 -9.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0958 -14.3125 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8250 -10.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6167 -10.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2042 -10.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1417 -8.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3667 -8.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 1 1 0
5 4 1 0
6 15 2 0
7 21 1 0
8 3 2 0
9 5 2 0
10 11 2 0
11 14 1 0
12 2 1 0
13 6 1 0
14 23 1 0
15 17 1 0
16 13 2 0
17 14 2 0
18 9 1 0
19 12 1 0
20 12 1 0
21 20 1 0
22 19 1 0
23 29 1 0
24 8 1 0
25 11 1 0
26 18 1 0
27 7 1 0
28 27 1 0
29 28 1 0
30 13 1 0
31 25 1 0
3 5 1 0
22 7 1 0
24 18 2 0
10 6 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.50Molecular Weight (Monoisotopic): 425.2115AlogP: 4.86#Rotatable Bonds: 8Polar Surface Area: 67.60Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.10CX LogP: 2.85CX LogD: 2.07Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.41Np Likeness Score: -1.49
References 1. Strupczewski JT, Bordeau KJ, Chiang Y, Glamkowski EJ, Conway PG, Corbett R, Hartman HB, Szewczak MR, Wilmot CA, Helsley GC.. (1995) 3-[[(Aryloxy)alkyl]piperidinyl]-1,2-benzisoxazoles as D2/5-HT2 antagonists with potential atypical antipsychotic activity: antipsychotic profile of iloperidone (HP 873)., 38 (7): [PMID:7707315 ] [10.1021/jm00007a009 ]